Difference between revisions of "Protein-N-terminal-L-Arginine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-N-terminal-L-Arginine Protein-N-terminal-L-Arginine] == * common name: ** a [protein] N...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-N-terminal-L-Arginine Protein-N-terminal-L-Arginine] ==
* smiles:
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
 
* common name:
 
* common name:
** chlorophyll a
+
** a [protein] N-terminal L-arginine
* molecular weight:
+
** 892.495   
+
 
* Synonym(s):
 
* Synonym(s):
** chlorophyll a (phytol)
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17428]]
 
* [[RXN-7666]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[ARGINYLTRANSFERASE-RXN]]
 
== External links  ==
 
== External links  ==
* CAS : 479-61-8
+
{{#set: common name=a [protein] N-terminal L-arginine}}
* PUBCHEM:
+
{{#set: reversible reaction associated=ARGINYLTRANSFERASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657767 90657767]
+
* KNAPSACK : C00001528
+
* HMDB : HMDB38578
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05306 C05306]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58416 58416]
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=chlorophyll a}}
+
{{#set: molecular weight=892.495    }}
+
{{#set: common name=chlorophyll a (phytol)}}
+
{{#set: produced by=RXN-17428|RXN-7666}}
+

Latest revision as of 19:25, 21 March 2018

Metabolite Protein-N-terminal-L-Arginine

  • common name:
    • a [protein] N-terminal L-arginine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein] N-terminal L-arginine" cannot be used as a page name in this wiki.