Difference between revisions of "PWY-321"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-321 PWY-321] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-321 PWY-321] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** cutin biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cutin monomer biosynthesis |
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | '''1''' reactions found over '''16''' reactions in the full pathway |
− | * [[RXN- | + | * [[RXN-16389]] |
− | == | + | ** 4 associated gene(s): |
+ | *** [[Ec-12_008720]] | ||
+ | *** [[Ec-01_001560]] | ||
+ | *** [[Ec-02_006430]] | ||
+ | *** [[Ec-03_003710]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PALMITOYL-COA-HYDROLASE-RXN PALMITOYL-COA-HYDROLASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1062 RXN-1062] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1064 RXN-1064] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1065 RXN-1065] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16398 RXN-16398] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16400 RXN-16400] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16416 RXN-16416] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16417 RXN-16417] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9666 RXN-9666] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9802 RXN-9802] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9803 RXN-9803] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9804 RXN-9804] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9805 RXN-9805] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9806 RXN-9806] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9807 RXN-9807] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-321 PWY-321] |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | {{#set: | + | {{#set: common name=cutin biosynthesis}} |
− | {{#set: | + | {{#set: common name=cutin monomer biosynthesis}} |
− | {{#set: common name= | + | {{#set: reaction found=1}} |
− | {{#set: | + | {{#set: total reaction=16}} |
− | {{#set: | + | {{#set: completion rate=6.0}} |
− | {{#set: | + |
Latest revision as of 19:25, 21 March 2018
Pathway PWY-321
- taxonomic range:
- common name:
- cutin biosynthesis
- Synonym(s):
- cutin monomer biosynthesis
Reaction(s) found
1 reactions found over 16 reactions in the full pathway
- RXN-16389
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- PALMITOYL-COA-HYDROLASE-RXN
- RXN-1062
- RXN-1064
- RXN-1065
- RXN-16398
- RXN-16400
- RXN-16416
- RXN-16417
- RXN-9666
- RXN-9802
- RXN-9803
- RXN-9804
- RXN-9805
- RXN-9806
- RXN-9807
External links
- ARACYC: