Difference between revisions of "Ec-10 005810"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == * smiles: ** C(C(C1(C=CC(=CC=1)O))OC2(OC(C(C(C2O)O)O)CO))#N * inchi key:...")
(Created page with "Category:Gene == Gene Ec-10_005810 == * left end position: ** 5903473 * transcription direction: ** NEGATIVE * right end position: ** 5915488 * centisome position: ** 90.8...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] ==
+
== Gene Ec-10_005810 ==
−
* smiles:
+
* left end position:
−
** C(C(C1(C=CC(=CC=1)O))OC2(OC(C(C(C2O)O)O)CO))#N
+
** 5903473
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NVLTYOJHPBMILU-GMDXDWKASA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** taxiphyllin
+
** 5915488
−
* molecular weight:
+
* centisome position:
−
** 311.291    
+
** 90.8089    
 
* Synonym(s):
 
* Synonym(s):
−
** (R)-4-hydroxymandelonitrile β-D-glucoside
+
** Esi_0006_0133
−
** (2R)-(β-D-glucopyranosyloxy)(4-hydroxyphenyl)acetonitrile
+
** Esi0006_0133
−
** (R)-alpha-(β-D-glucopyranosyloxy)-4-hydroxybenzeneacetonitrile
+
** NDA
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13600]]
+
* Reaction: [[NADH-DEHYDROG-A-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6692]]
 +
* [[PWY-3781]]
 +
* [[PWY-5083]]
 +
* [[PWY0-1335]]
 +
* [[PWY0-1334]]
 +
* [[PWY-4302]]
 
== External links  ==
 
== External links  ==
−
* CAS : 21401-21-8
+
{{#set: left end position=5903473}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107721 107721]
+
{{#set: right end position=5915488}}
−
* HMDB : HMDB30704
+
{{#set: centisome position=90.8089   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0006_0133|Esi0006_0133|NDA}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01855 C01855]
+
{{#set: reaction associated=NADH-DEHYDROG-A-RXN}}
−
* CHEMSPIDER:
+
{{#set: pathway associated=PWY-6692|PWY-3781|PWY-5083|PWY0-1335|PWY0-1334|PWY-4302}}
−
** [http://www.chemspider.com/Chemical-Structure.96890.html 96890]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16267 16267]
+
−
{{#set: smiles=C(C(C1(C=CC(=CC=1)O))OC2(OC(C(C(C2O)O)O)CO))#N}}
+
−
{{#set: inchi key=InChIKey=NVLTYOJHPBMILU-GMDXDWKASA-N}}
+
−
{{#set: common name=taxiphyllin}}
+
−
{{#set: molecular weight=311.291   }}
+
−
{{#set: common name=(R)-4-hydroxymandelonitrile β-D-glucoside|(2R)-(β-D-glucopyranosyloxy)(4-hydroxyphenyl)acetonitrile|(R)-alpha-(β-D-glucopyranosyloxy)-4-hydroxybenzeneacetonitrile}}
+
−
{{#set: consumed by=RXN-13600}}
+

Latest revision as of 19:26, 21 March 2018

Gene Ec-10_005810

  • left end position:
    • 5903473
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5915488
  • centisome position:
    • 90.8089
  • Synonym(s):
    • Esi_0006_0133
    • Esi0006_0133
    • NDA

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-10_005810&oldid=26852"