Difference between revisions of "RXN-10720"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10720 RXN-10720] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10720 RXN-10720] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CPD-476]][c] '''=>''' 1 [[KYNURENATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[WATER]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 4-(2-aminophenyl)-2,4-dioxobutanoate[c] '''=>''' 1 kynurenate[c] '''+''' 1 H+[c] '''+''' 1 H2O[c] |
− | * [[ | + | |
− | + | == Genes associated with this reaction == | |
+ | == Pathways == | ||
+ | * [[PWY-6309]], L-tryptophan degradation XI (mammalian, via kynurenine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6309 PWY-6309] | ||
+ | ** '''8''' reactions found over '''17''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03445 R03445] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: in pathway=PWY-6309}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | * LIGAND- | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction tool=pathwaytools}} |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:26, 21 March 2018
Contents
Reaction RXN-10720
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-476[c] => 1 KYNURENATE[c] + 1 PROTON[c] + 1 WATER[c]
- With common name(s):
- 1 4-(2-aminophenyl)-2,4-dioxobutanoate[c] => 1 kynurenate[c] + 1 H+[c] + 1 H2O[c]
Genes associated with this reaction
Pathways
- PWY-6309, L-tryptophan degradation XI (mammalian, via kynurenine): PWY-6309
- 8 reactions found over 17 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN: