Difference between revisions of "PWY-6317"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * inchi key: ** InChIKey=WX...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6317 PWY-6317] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6317 PWY-6317] ==
−
* smiles:
+
* taxonomic range:
−
** C(C(=O)C([O-])=O)C(C([O-])=O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
−
** InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** (4S)-4-hydroxy-2-oxoglutarate
+
** D-galactose degradation I (Leloir pathway)
−
* molecular weight:
+
−
** 160.083   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-4-hydroxy-2-oxoglutarate
+
** Leloir pathway
−
** L-4-hydroxy-2-ketoglutarate
+
−
** (S)-2-hydroxy-4-oxopentanedioate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[ALDOSE1EPIM-RXN]]
−
* [[RXN-13990]]
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[GALACTOKIN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-04_000280]]
 +
*** [[Ec-04_004180]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-00_010010]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PHOSPHOGLUCMUT-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-17_001480]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-04_000280]]
 +
*** [[Ec-04_004180]]
 +
*** [[Ec-05_006710]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698337 70698337]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=GALACTMETAB-PWY GALACTMETAB-PWY]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-4751}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71685 71685]
+
{{#set: taxonomic range=TAX-3193}}
−
* METABOLIGHTS : MTBLC71685
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: smiles=C(C(=O)C([O-])=O)C(C([O-])=O)O}}
+
{{#set: common name=D-galactose degradation I (Leloir pathway)}}
−
{{#set: inchi key=InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L}}
+
{{#set: common name=Leloir pathway}}
−
{{#set: common name=(4S)-4-hydroxy-2-oxoglutarate}}
+
{{#set: reaction found=5}}
−
{{#set: molecular weight=160.083    }}
+
{{#set: total reaction=5}}
−
{{#set: common name=L-4-hydroxy-2-oxoglutarate|L-4-hydroxy-2-ketoglutarate|(S)-2-hydroxy-4-oxopentanedioate}}
+
{{#set: completion rate=100.0}}
−
{{#set: reversible reaction associated=RXN-13990}}
+

Latest revision as of 19:30, 21 March 2018

Pathway PWY-6317

  • taxonomic range:
  • common name:
    • D-galactose degradation I (Leloir pathway)
  • Synonym(s):
    • Leloir pathway

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6317&oldid=27347"