Difference between revisions of "PWY-6317"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * inchi key: ** InChIKey=WX...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6317 PWY-6317] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6317 PWY-6317] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** ( | + | ** D-galactose degradation I (Leloir pathway) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Leloir pathway |
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''5''' reactions found over '''5''' reactions in the full pathway | |
− | + | * [[ALDOSE1EPIM-RXN]] | |
− | * [[RXN- | + | ** 0 associated gene: |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[GALACTOKIN-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-04_000280]] | ||
+ | *** [[Ec-04_004180]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[GALACTURIDYLYLTRANS-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-00_010010]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[PHOSPHOGLUCMUT-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-17_001480]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[UDPGLUCEPIM-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-04_000280]] | ||
+ | *** [[Ec-04_004180]] | ||
+ | *** [[Ec-05_006710]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=GALACTMETAB-PWY GALACTMETAB-PWY] |
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-3193}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | {{#set: | + | {{#set: common name=D-galactose degradation I (Leloir pathway)}} |
− | {{#set: | + | {{#set: common name=Leloir pathway}} |
− | {{#set: common name=( | + | {{#set: reaction found=5}} |
− | {{#set: | + | {{#set: total reaction=5}} |
− | {{#set: | + | {{#set: completion rate=100.0}} |
− | {{#set: | + |
Latest revision as of 19:30, 21 March 2018
Pathway PWY-6317
- taxonomic range:
- common name:
- D-galactose degradation I (Leloir pathway)
- Synonym(s):
- Leloir pathway
Reaction(s) found
5 reactions found over 5 reactions in the full pathway
- ALDOSE1EPIM-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- GALACTOKIN-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- GALACTURIDYLYLTRANS-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- PHOSPHOGLUCMUT-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- UDPGLUCEPIM-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: