Difference between revisions of "Ec-07 007430"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == * smiles: ** C([O-])(=O)C(=O)CC1(=CC=CC=C1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-07_007430 == * left end position: ** 7126835 * transcription direction: ** POSITIVE * right end position: ** 7127596 * centisome position: ** 92.2...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-07_007430 == |
− | * | + | * left end position: |
− | ** | + | ** 7126835 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 7127596 |
− | * | + | * centisome position: |
− | ** | + | ** 92.28747 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0305_0020 |
− | ** | + | ** Esi0305_0020 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[AMINOCYL-TRNA-HYDROLASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: go-term | |
− | + | * Reaction: [[RXN-12460]] | |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
− | * [[ | + | * Reaction: [[RXN-16637]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
+ | *** Assignment: go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY490-4]] | ||
+ | * [[PWY-6308]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7126835}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=7127596}} | |
− | + | {{#set: centisome position=92.28747 }} | |
− | + | {{#set: common name=Esi_0305_0020|Esi0305_0020}} | |
− | + | {{#set: reaction associated=AMINOCYL-TRNA-HYDROLASE-RXN|RXN-12460|RXN-16637}} | |
− | + | {{#set: pathway associated=PWY490-4|PWY-6308}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:32, 21 March 2018
Gene Ec-07_007430
- left end position:
- 7126835
- transcription direction:
- POSITIVE
- right end position:
- 7127596
- centisome position:
- 92.28747
- Synonym(s):
- Esi_0305_0020
- Esi0305_0020
Reactions associated
- Reaction: AMINOCYL-TRNA-HYDROLASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12460
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-16637
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome