|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLULOSE-5-PHOSPHATE XYLULOSE-5-PHOSPHATE] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C(OP([O-])(=O)[O-])C(O)C(O)C(=O)CO |
| + | * inchi key: |
| + | ** InChIKey=FNZLKVNUWIIPSJ-RFZPGFLSSA-L |
| * common name: | | * common name: |
− | ** Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain | + | ** D-xylulose 5-phosphate |
− | ** SDH1, succinate dehydrogenase subunit 1 | + | * molecular weight: |
− | ** SDH3, succinate dehydrogenase subunit 3
| + | ** 228.095 |
− | ** SDH2, succinate dehydrogenase subunit 2
| + | |
− | ** SDH4, succinate dehydrogenase subunit 4
| + | |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/1.3.5.1 EC-1.3.5.1] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** xylulose 5-phosphate |
| + | ** xylulose-phosphate |
| + | ** D-xylulose-5-P |
| + | ** xylulose-P |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[SUC]][c] '''+''' 1 [[Ubiquinones]][c] '''=>''' 1 [[Ubiquinols]][c] '''+''' 1 [[FUM]][c]
| + | * [[XYLULOKIN-RXN]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 succinate[c] '''+''' 1 a ubiquinone[c] '''=>''' 1 an ubiquinol[c] '''+''' 1 fumarate[c]
| + | * [[2TRANSKETO-RXN]] |
− | | + | * [[1TRANSKETO-RXN]] |
− | == Genes associated with this reaction ==
| + | * [[RIBULP3EPIM-RXN]] |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-07_002870]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-07_007310]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-11_000360]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-21_003470]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Ec-05_003640]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Ec-27_006560]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | == Pathways == | + | |
− | * [[PWY-561]], superpathway of glyoxylate cycle and fatty acid degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-561 PWY-561]
| + | |
− | ** '''6''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-4302]], aerobic respiration III (alternative oxidase pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4302 PWY-4302]
| + | |
− | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-3781]], aerobic respiration I (cytochrome c): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3781 PWY-3781]
| + | |
− | ** '''4''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-7279]], aerobic respiration II (cytochrome c) (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7279 PWY-7279]
| + | |
− | ** '''4''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-6728]], methylaspartate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728] | + | |
− | ** '''11''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[PWY0-1329]], succinate to cytochrome bo oxidase electron transfer: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1329 PWY0-1329]
| + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY0-1353]], succinate to cytochrome bd oxidase electron transfer: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1353 PWY0-1353]
| + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY-5690]], TCA cycle II (plants and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690]
| + | |
− | ** '''8''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY66-398]], TCA cycle III (animals): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398] | + | |
− | ** '''10''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[TCA]], TCA cycle I (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=TCA TCA] | + | |
− | ** '''9''' reactions found over '''10''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]] | + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 60802-29-1 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13713 13713]
| + | * BIGG : 34329 |
− | * LIGAND-RXN:
| + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R02164 R02164]
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459820 5459820] |
− | * PIR: | + | * HMDB : HMDB00868 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T50081 T50081] | + | * LIGAND-CPD: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T46878 T46878] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00231 C00231] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T41753 T41753]
| + | * CHEMSPIDER: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T37633 T37633]
| + | ** [http://www.chemspider.com/Chemical-Structure.20015725.html 20015725] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T11245 T11245] | + | * CHEBI: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T11229 T11229] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57737 57737] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T11218 T11218]
| + | * METABOLIGHTS : MTBLC57737 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S78180 S78180] | + | {{#set: smiles=C(OP([O-])(=O)[O-])C(O)C(O)C(=O)CO}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S78179 S78179] | + | {{#set: inchi key=InChIKey=FNZLKVNUWIIPSJ-RFZPGFLSSA-L}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S78178 S78178] | + | {{#set: common name=D-xylulose 5-phosphate}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S74810 S74810]
| + | {{#set: molecular weight=228.095 }} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S62756 S62756] | + | {{#set: common name=xylulose 5-phosphate|xylulose-phosphate|D-xylulose-5-P|xylulose-P}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S62755 S62755] | + | {{#set: produced by=XYLULOKIN-RXN}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S59115 S59115]
| + | {{#set: reversible reaction associated=2TRANSKETO-RXN|1TRANSKETO-RXN|RIBULP3EPIM-RXN}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S59114 S59114]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S56817 S56817] | + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S34793 S34793]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S26978 S26978]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S25968 S25968]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=RDBYIS RDBYIS]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=PT0094 PT0094]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JX0336 JX0336]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I38895 I38895]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=D81388 D81388]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=D71712 D71712]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=D32394 D32394]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=C32394 C32394]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=B58930 B58930]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=B32394 B32394]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A56660 A56660]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A45159 A45159]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A42792 A42792]
| + | |
− | * UNIPROT:
| + | |
− | ** [http://www.uniprot.org/uniprot/P35720 P35720]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q26266 Q26266]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21913 P21913]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZZR2 Q9ZZR2]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21911 P21911]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZEA1 Q9ZEA1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PI67 Q9PI67]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21912 P21912]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31040 P31040]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CQA3 Q9CQA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21801 P21801]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35721 P35721]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32420 P32420]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00711 Q00711]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47052 P47052]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48932 P48932]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48934 P48934]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48935 P48935]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48933 P48933]
| + | |
− | ** [http://www.uniprot.org/uniprot/P73723 P73723]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80481 P80481]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80482 P80482]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80480 P80480]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9T584 Q9T584]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80479 P80479]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80478 P80478]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q09508 Q09508]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59659 Q59659]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UTJ7 Q9UTJ7]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}}
| + | |
− | {{#set: common name=Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain}} | + | |
− | {{#set: common name=SDH1, succinate dehydrogenase subunit 1}}
| + | |
− | {{#set: common name=SDH3, succinate dehydrogenase subunit 3}} | + | |
− | {{#set: common name=SDH2, succinate dehydrogenase subunit 2}} | + | |
− | {{#set: common name=SDH4, succinate dehydrogenase subunit 4}} | + | |
− | {{#set: ec number=EC-1.3.5.1}}
| + | |
− | {{#set: gene associated=Ec-07_002870|Ec-07_007310|Ec-11_000360|Ec-21_003470|Ec-05_003640|Ec-27_006560}}
| + | |
− | {{#set: in pathway=PWY-561|PWY-4302|PWY-3781|PWY-7279|PWY-6728|PWY0-1329|PWY0-1353|PWY-5690|PWY66-398|TCA}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |