Difference between revisions of "Ec-06 007860"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] == * smiles: ** C([O-])(=O)C(=CC(=O)[O-])CC(=O)[O-] * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-06_007860 == * left end position: ** 5523396 * transcription direction: ** NEGATIVE * right end position: ** 5532742 * centisome position: ** 63.0...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_007860 == |
− | * | + | * left end position: |
− | ** | + | ** 5523396 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5532742 |
− | * | + | * centisome position: |
− | ** | + | ** 63.068604 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0028_0096 |
− | ** | + | ** Esi0028_0096 |
+ | ** CAMK | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PROTEIN-KINASE-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: go-term | |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=5523396}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5532742}} | |
− | + | {{#set: centisome position=63.068604 }} | |
− | + | {{#set: common name=Esi_0028_0096|Esi0028_0096|CAMK}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:35, 21 March 2018
Gene Ec-06_007860
- left end position:
- 5523396
- transcription direction:
- NEGATIVE
- right end position:
- 5532742
- centisome position:
- 63.068604
- Synonym(s):
- Esi_0028_0096
- Esi0028_0096
- CAMK
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome