Difference between revisions of "Ec-21 003710"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13040 CPD-13040] == * smiles: ** CCCC(OCC(OC(CCC)=O)CO)=O * inchi key: ** InChIKey=AWHAUPZH...")
(Created page with "Category:Gene == Gene Ec-21_003710 == * Synonym(s): ** Esi_0072_0104 ** Esi0072_0104 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13040 CPD-13040] ==
+
== Gene Ec-21_003710 ==
−
* smiles:
+
−
** CCCC(OCC(OC(CCC)=O)CO)=O
+
−
* inchi key:
+
−
** InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N
+
−
* common name:
+
−
** 1,2-dibutyrin
+
−
* molecular weight:
+
−
** 232.276   
+
 
* Synonym(s):
 
* Synonym(s):
−
** glycerol 1,2-dibutanoate
+
** Esi_0072_0104
−
** β-dibutyrin
+
** Esi0072_0104
−
** butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester
+
−
** dibutyrylglycerol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-8443]]
−
* [[RXN-12086]]
+
** Source: [[orthology-aragem]]
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
−
* CAS : 24814-35-5
+
{{#set: common name=Esi_0072_0104|Esi0072_0104}}
−
* PUBCHEM:
+
{{#set: reaction associated=RXN-8443}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5327007 5327007]
+
{{#set: pathway associated=PWY-5381}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.8352519.html 8352519]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76537 76537]
+
−
{{#set: smiles=CCCC(OCC(OC(CCC)=O)CO)=O}}
+
−
{{#set: inchi key=InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N}}
+
−
{{#set: common name=1,2-dibutyrin}}
+
−
{{#set: molecular weight=232.276    }}
+
−
{{#set: common name=glycerol 1,2-dibutanoate|β-dibutyrin|butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester|dibutyrylglycerol}}
+
−
{{#set: produced by=RXN-12086}}
+

Latest revision as of 19:40, 21 March 2018

Gene Ec-21_003710

  • Synonym(s):
    • Esi_0072_0104
    • Esi0072_0104

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-21_003710&oldid=28577"