Difference between revisions of "CPD-7066"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-25_000100 == * left end position: ** 124970 * transcription direction: ** POSITIVE * right end position: ** 134894 * centisome position: ** 2.8077...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == * smiles: ** CC(C(=O)[O-])C(O)C([O-])=O * inchi key: ** InChIKey=NPYQJIHH...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C(=O)[O-])C(O)C([O-])=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L |
| − | * | + | * common name: |
| − | ** | + | ** (2R,3S)-3-methylmalate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 146.099 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** D-erythro-3-methylmalate |
| − | ** | + | ** erythro-β-methyl-D-malate |
| + | ** β-erythro-methylmalate | ||
| + | ** β-methyl-D-malate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-7745]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266666 45266666] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58511 58511] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06029 C06029] |
| + | {{#set: smiles=CC(C(=O)[O-])C(O)C([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L}} | ||
| + | {{#set: common name=(2R,3S)-3-methylmalate}} | ||
| + | {{#set: molecular weight=146.099 }} | ||
| + | {{#set: common name=D-erythro-3-methylmalate|erythro-β-methyl-D-malate|β-erythro-methylmalate|β-methyl-D-malate}} | ||
| + | {{#set: consumed by=RXN-7745}} | ||
Latest revision as of 19:40, 21 March 2018
Contents
Metabolite CPD-7066
- smiles:
- CC(C(=O)[O-])C(O)C([O-])=O
- inchi key:
- InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L
- common name:
- (2R,3S)-3-methylmalate
- molecular weight:
- 146.099
- Synonym(s):
- D-erythro-3-methylmalate
- erythro-β-methyl-D-malate
- β-erythro-methylmalate
- β-methyl-D-malate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(=O)[O-])C(O)C([O-])=O" cannot be used as a page name in this wiki.
