Difference between revisions of "Ec-11 002070"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])...")
(Created page with "Category:Gene == Gene Ec-11_002070 == * left end position: ** 2184951 * transcription direction: ** POSITIVE * right end position: ** 2190910 * centisome position: ** 34.7...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] ==
+
== Gene Ec-11_002070 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2184951
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-oxopimeloyl-CoA
+
** 2190910
−
* molecular weight:
+
* centisome position:
−
** 918.632    
+
** 34.73879    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxopimelyl-CoA
+
** Esi_0157_0025
−
** 3-ketopimeloyl-CoA
+
** Esi0157_0025
−
** 3-ketopimelyl-CoA
+
** Adsl
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[AICARSYN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-8032]]
+
*** Assignment: ec-number
 +
* Reaction: [[AMPSYN-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7219]]
 +
* [[PWY-6123]]
 +
* [[PWY-6124]]
 +
* [[PWY-7234]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2184951}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266579 45266579]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2190910}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57350 57350]
+
{{#set: centisome position=34.73879   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0157_0025|Esi0157_0025|Adsl}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06715 C06715]
+
{{#set: reaction associated=AICARSYN-RXN|AMPSYN-RXN}}
−
* HMDB : HMDB12158
+
{{#set: pathway associated=PWY-7219|PWY-6123|PWY-6124|PWY-7234}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I}}
+
−
{{#set: common name=3-oxopimeloyl-CoA}}
+
−
{{#set: molecular weight=918.632   }}
+
−
{{#set: common name=3-oxopimelyl-CoA|3-ketopimeloyl-CoA|3-ketopimelyl-CoA}}
+
−
{{#set: reversible reaction associated=RXN-8032}}
+

Latest revision as of 19:44, 21 March 2018

Gene Ec-11_002070

  • left end position:
    • 2184951
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2190910
  • centisome position:
    • 34.73879
  • Synonym(s):
    • Esi_0157_0025
    • Esi0157_0025
    • Adsl

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-11_002070&oldid=29039"