Difference between revisions of "RXN-15511"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * inchi key: ** InChIKey=AWU...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15511 RXN-15511] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15511 RXN-15511] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * | + | * With identifiers: |
| − | * [[ | + | ** 1 [[Protein-Histidines]][c] '''+''' 1 [[23-DIPHOSPHOGLYCERATE]][c] '''<=>''' 1 [[Protein-pi-phospho-L-histidines]][c] '''+''' 1 [[G3P]][c] |
| − | + | * With common name(s): | |
| − | + | ** 1 a [protein]-L-histidine[c] '''+''' 1 2,3-diphospho-D-glycerate[c] '''<=>''' 1 a [protein]-Nπ-phospho-L-histidine[c] '''+''' 1 3-phospho-D-glycerate[c] | |
| − | + | ||
| − | + | == Genes associated with this reaction == | |
| − | + | == Pathways == | |
| − | + | * [[PWY-6405]], Rapoport-Luebering glycolytic shunt: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6405 PWY-6405] | |
| − | + | ** '''1''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[ | + | == Reconstruction information == |
| − | + | * Category: [[annotation]] | |
| − | == | + | ** Source: [[annotation-esiliculosus_genome]] |
| − | + | *** Tool: [[pathwaytools]] | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | * | + | |
| − | == | + | |
| − | * [[ | + | |
| − | * | + | |
| − | * [[ | + | |
| − | * | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: in pathway=PWY-6405}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:50, 21 March 2018
Contents
Reaction RXN-15511
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Protein-Histidines[c] + 1 23-DIPHOSPHOGLYCERATE[c] <=> 1 Protein-pi-phospho-L-histidines[c] + 1 G3P[c]
- With common name(s):
- 1 a [protein]-L-histidine[c] + 1 2,3-diphospho-D-glycerate[c] <=> 1 a [protein]-Nπ-phospho-L-histidine[c] + 1 3-phospho-D-glycerate[c]
Genes associated with this reaction
Pathways
- PWY-6405, Rapoport-Luebering glycolytic shunt: PWY-6405
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
