Difference between revisions of "CPD-12481"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14476 RXN-14476] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * inchi key: ** InChIKey=Y...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14476 RXN-14476] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.3.1.79 EC-1.3.1.79]
+
** InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
 +
* common name:
 +
** 7-methylurate
 +
* molecular weight:
 +
** 182.138   
 
* Synonym(s):
 
* Synonym(s):
 +
** 7-methyluric acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[CPD-659]][c] '''<=>''' 1 [[TYR]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
* [[RXN-11521]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NAD(P)+[c] '''+''' 1 L-arogenate[c] '''<=>''' 1 L-tyrosine[c] '''+''' 1 NAD(P)H[c] '''+''' 1 CO2[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[gap-filling]]
+
−
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
−
*** Tool: [[meneco]]
+
−
**** Comment: [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.3.1.79}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69160 69160]
−
{{#set: in pathway=}}
+
* CHEMSPIDER:
−
{{#set: reconstruction category=gap-filling}}
+
** [http://www.chemspider.com/Chemical-Structure.62375.html 62375]
−
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
+
* CHEBI:
−
{{#set: reconstruction tool=meneco}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80470 80470]
−
{{#set: reconstruction comment=added for gapfilling}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C16355 C16355]
 +
* HMDB : HMDB11107
 +
{{#set: smiles=CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))}}
 +
{{#set: inchi key=InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N}}
 +
{{#set: common name=7-methylurate}}
 +
{{#set: molecular weight=182.138    }}
 +
{{#set: common name=7-methyluric acid}}
 +
{{#set: produced by=RXN-11521}}

Latest revision as of 19:56, 21 March 2018

Metabolite CPD-12481

  • smiles:
    • CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
  • inchi key:
    • InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
  • common name:
    • 7-methylurate
  • molecular weight:
    • 182.138
  • Synonym(s):
    • 7-methyluric acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-12481&oldid=30433"