Difference between revisions of "BETAINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1425 CPD0-1425] == * smiles: ** CCCCCCCCCCCCCC(=O)OCC(OC(CCCCCCCCCCCCC)=O)COP([O-])(=O)[O-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE BETAINE] == * smiles: ** C[N+](C)(CC([O-])=O)C * inchi key: ** InChIKey=KWIUHFFTVRNATP-...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE BETAINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C[N+](C)(CC([O-])=O)C |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=KWIUHFFTVRNATP-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** glycine betaine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 117.147 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** oxyneurine |
| + | ** lycine | ||
| + | ** acidin-pepsin | ||
| + | ** betaine | ||
| + | ** trimethylammonioacetate | ||
| + | ** N,N,N-trimethylglycine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13406]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[BADH-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 107-43-7 | ||
| + | * METABOLIGHTS : MTBLC17750 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=247 247] |
| + | * HMDB : HMDB00043 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00719 C00719] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.242.html 242] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17750 17750] |
| − | {{#set: smiles= | + | * BIGG : 35786 |
| − | {{#set: inchi key=InChIKey= | + | * BIGG : glyb |
| − | {{#set: common name= | + | {{#set: smiles=C[N+](C)(CC([O-])=O)C}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=KWIUHFFTVRNATP-UHFFFAOYSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=glycine betaine}} |
| − | {{#set: produced by=RXN- | + | {{#set: molecular weight=117.147 }} |
| + | {{#set: common name=oxyneurine|lycine|acidin-pepsin|betaine|trimethylammonioacetate|N,N,N-trimethylglycine}} | ||
| + | {{#set: produced by=RXN-13406}} | ||
| + | {{#set: reversible reaction associated=BADH-RXN}} | ||
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite BETAINE
- smiles:
- C[N+](C)(CC([O-])=O)C
- inchi key:
- InChIKey=KWIUHFFTVRNATP-UHFFFAOYSA-N
- common name:
- glycine betaine
- molecular weight:
- 117.147
- Synonym(s):
- oxyneurine
- lycine
- acidin-pepsin
- betaine
- trimethylammonioacetate
- N,N,N-trimethylglycine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 107-43-7
- METABOLIGHTS : MTBLC17750
- PUBCHEM:
- HMDB : HMDB00043
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 35786
- BIGG : glyb
"C[N+](C)(CC([O-])=O)C" cannot be used as a page name in this wiki.
