Difference between revisions of "CPD1F-139"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-adenine-37 tRNA-adenine-37] == * common name: ** an adenine37 in tRNA * Synonym(s): == Re...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-adenine-37 tRNA-adenine-37] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] ==
 +
* smiles:
 +
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
 +
* inchi key:
 +
** InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M
 
* common name:
 
* common name:
** an adenine37 in tRNA
+
** gibberellin A1
 +
* molecular weight:
 +
** 347.387   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA1
 +
** gibberellin 1
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14570]]
+
* [[RXN-115]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=an adenine37 in tRNA}}
+
* PUBCHEM:
{{#set: consumed by=RXN-14570}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202506 25202506]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27717 27717]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00859 C00859]
 +
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
 +
{{#set: inchi key=InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M}}
 +
{{#set: common name=gibberellin A1}}
 +
{{#set: molecular weight=347.387    }}
 +
{{#set: common name=GA1|gibberellin 1}}
 +
{{#set: consumed by=RXN-115}}

Latest revision as of 19:59, 21 March 2018

Metabolite CPD1F-139

  • smiles:
    • C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • inchi key:
    • InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M
  • common name:
    • gibberellin A1
  • molecular weight:
    • 347.387
  • Synonym(s):
    • GA1
    • gibberellin 1

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.