Difference between revisions of "Mitochondrial-Preproteins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBALT-SIROHYDROCHLORIN COBALT-SIROHYDROCHLORIN] == * smiles: ** CC1(CC(=O)[O-])(C2(=CC5(C(CCC(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mitochondrial-Preproteins Mitochondrial-Preproteins] == * common name: ** a mitochondrial prepr...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBALT-SIROHYDROCHLORIN COBALT-SIROHYDROCHLORIN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mitochondrial-Preproteins Mitochondrial-Preproteins] ==
* smiles:
+
** CC1(CC(=O)[O-])(C2(=CC5(C(CCC(=O)[O-])C(C)(CC(=O)[O-])C6(=CC4(=C(CC(=O)[O-])C(CCC(=O)[O-])=C3(C=C8(C(CCC(=O)[O-])=C(CC(=O)[O-])C7(C=C(C(CCC(=O)[O-])1)N2[Co--](N34)([N+]=56)[N+]=78))))))))
+
* inchi key:
+
** InChIKey=XZMXJYDTAININL-QIISWYHFSA-D
+
 
* common name:
 
* common name:
** cobalt-sirohydrochlorin
+
** a mitochondrial preprotein including a mitochondrial targeting sequence
* molecular weight:
+
** 911.694   
+
 
* Synonym(s):
 
* Synonym(s):
** cobalt-factor II
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.4.24.64-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4.99.1.3-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a mitochondrial preprotein including a mitochondrial targeting sequence}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678581 70678581]
+
{{#set: consumed by=3.4.24.64-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60049 60049]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11538 C11538]
+
{{#set: smiles=CC1(CC(=O)[O-])(C2(=CC5(C(CCC(=O)[O-])C(C)(CC(=O)[O-])C6(=CC4(=C(CC(=O)[O-])C(CCC(=O)[O-])=C3(C=C8(C(CCC(=O)[O-])=C(CC(=O)[O-])C7(C=C(C(CCC(=O)[O-])1)N2[Co--](N34)([N+]=56)[N+]=78))))))))}}
+
{{#set: inchi key=InChIKey=XZMXJYDTAININL-QIISWYHFSA-D}}
+
{{#set: common name=cobalt-sirohydrochlorin}}
+
{{#set: molecular weight=911.694    }}
+
{{#set: common name=cobalt-factor II}}
+
{{#set: produced by=4.99.1.3-RXN}}
+

Latest revision as of 19:59, 21 March 2018

Metabolite Mitochondrial-Preproteins

  • common name:
    • a mitochondrial preprotein including a mitochondrial targeting sequence
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links