Difference between revisions of "Xyloglucans-Galactose-23"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] == * smiles: ** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2)) * inchi...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Xyloglucans-Galactose-23 Xyloglucans-Galactose-23] == * common name: ** an XLLG xylogulcan * Sy...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Xyloglucans-Galactose-23 Xyloglucans-Galactose-23] ==
* smiles:
+
** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2))
+
* inchi key:
+
** InChIKey=NOTGFIUVDGNKRI-UUOKFMHZSA-L
+
 
* common name:
 
* common name:
** 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide
+
** an XLLG xylogulcan
* molecular weight:
+
** 336.197   
+
 
* Synonym(s):
 
* Synonym(s):
** Z-nucleotide
+
** a xyloglucan with galactose side chain at positions 2 and 3
** AICAR
+
** AICA ribonucleotide
+
** 5'-phosphoribosyl-5-amino-4-imidazole carboxamide
+
** 5-amino-4-imidazolecarboxamide ribotide
+
** 5'-P-ribosyl-5-amino-4-imidazole carboxamide
+
** aminoimidazole carboxamide ribonucleotide
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9463]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUTAMIDOTRANS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-14270]]
 
* [[AICARSYN-RXN]]
 
* [[AICARTRANSFORM-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 3031-94-5
+
{{#set: common name=an XLLG xylogulcan}}
* BIGG : 44312
+
{{#set: common name=a xyloglucan with galactose side chain at positions 2 and 3}}
* PUBCHEM:
+
{{#set: consumed by=RXN-9463}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266657 45266657]
+
* HMDB : HMDB01517
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04677 C04677]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58475 58475]
+
* METABOLIGHTS : MTBLC58475
+
{{#set: smiles=C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2))}}
+
{{#set: inchi key=InChIKey=NOTGFIUVDGNKRI-UUOKFMHZSA-L}}
+
{{#set: common name=5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide}}
+
{{#set: molecular weight=336.197    }}
+
{{#set: common name=Z-nucleotide|AICAR|AICA ribonucleotide|5'-phosphoribosyl-5-amino-4-imidazole carboxamide|5-amino-4-imidazolecarboxamide ribotide|5'-P-ribosyl-5-amino-4-imidazole carboxamide|aminoimidazole carboxamide ribonucleotide}}
+
{{#set: produced by=GLUTAMIDOTRANS-RXN}}
+
{{#set: reversible reaction associated=RXN-14270|AICARSYN-RXN|AICARTRANSFORM-RXN}}
+

Latest revision as of 19:59, 21 March 2018

Metabolite Xyloglucans-Galactose-23

  • common name:
    • an XLLG xylogulcan
  • Synonym(s):
    • a xyloglucan with galactose side chain at positions 2 and 3

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links