Difference between revisions of "Xyloglucans-Galactose-23"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] == * smiles: ** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2)) * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Xyloglucans-Galactose-23 Xyloglucans-Galactose-23] == * common name: ** an XLLG xylogulcan * Sy...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Xyloglucans-Galactose-23 Xyloglucans-Galactose-23] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an XLLG xylogulcan |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a xyloglucan with galactose side chain at positions 2 and 3 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-9463]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=an XLLG xylogulcan}} | |
− | + | {{#set: common name=a xyloglucan with galactose side chain at positions 2 and 3}} | |
− | + | {{#set: consumed by=RXN-9463}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite Xyloglucans-Galactose-23
- common name:
- an XLLG xylogulcan
- Synonym(s):
- a xyloglucan with galactose side chain at positions 2 and 3