Difference between revisions of "CPD-13122"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VibB VibB] == * common name: ** an apo-[VibB aryl-carrier protein] * Synonym(s): == Reaction(s...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == * smiles: ** C(C1(OC(C(C(C=1)O)O)O))([O-])=O * inchi key: ** InChIKey=I...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == |
| + | * smiles: | ||
| + | ** C(C1(OC(C(C(C=1)O)O)O))([O-])=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-deoxy-L-threo-hex-4-enopyranuronate |
| + | * molecular weight: | ||
| + | ** 175.118 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid | ||
| + | ** 4-deoxy-L-threo-5-hexosulose-uronic acid | ||
| + | ** 4-deoxy-L-threo-5-hexosulose-uronate | ||
| + | ** 4-deoxy-L-threo-hex-4-enopyranuronate | ||
| + | ** 4-deoxy-β-L-threo-hex-4-enopyranuronose | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12178]] | ||
| + | * [[RXN-12270]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[RXN-16475]] |
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: reversible reaction associated=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819971 91819971] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62482 62482] | ||
| + | {{#set: smiles=C(C1(OC(C(C(C=1)O)O)O))([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M}} | ||
| + | {{#set: common name=4-deoxy-L-threo-hex-4-enopyranuronate}} | ||
| + | {{#set: molecular weight=175.118 }} | ||
| + | {{#set: common name=(3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid|4-deoxy-L-threo-5-hexosulose-uronic acid|4-deoxy-L-threo-5-hexosulose-uronate|4-deoxy-L-threo-hex-4-enopyranuronate|4-deoxy-β-L-threo-hex-4-enopyranuronose}} | ||
| + | {{#set: produced by=RXN-12178|RXN-12270}} | ||
| + | {{#set: reversible reaction associated=RXN-16475}} | ||
Latest revision as of 19:02, 21 March 2018
Contents
Metabolite CPD-13122
- smiles:
- C(C1(OC(C(C(C=1)O)O)O))([O-])=O
- inchi key:
- InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M
- common name:
- 4-deoxy-L-threo-hex-4-enopyranuronate
- molecular weight:
- 175.118
- Synonym(s):
- (3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid
- 4-deoxy-L-threo-5-hexosulose-uronic acid
- 4-deoxy-L-threo-5-hexosulose-uronate
- 4-deoxy-L-threo-hex-4-enopyranuronate
- 4-deoxy-β-L-threo-hex-4-enopyranuronose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C=1)O)O)O))([O-])=O" cannot be used as a page name in this wiki.
