Difference between revisions of "Ec-22 000810"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=R...") |
(Created page with "Category:Gene == Gene Ec-22_000810 == * left end position: ** 948281 * transcription direction: ** POSITIVE * right end position: ** 960911 * centisome position: ** 20.998...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-22_000810 == |
− | * | + | * left end position: |
− | ** | + | ** 948281 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 960911 |
− | * | + | * centisome position: |
− | ** | + | ** 20.998943 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0065_0090 |
+ | ** Esi0065_0090 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
+ | * [[UDPNACETYLGALSYN-PWY]] | ||
+ | * [[PWY-6749]] | ||
+ | * [[UDPNAGSYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=948281}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=960911}} | |
− | + | {{#set: centisome position=20.998943 }} | |
− | + | {{#set: common name=Esi_0065_0090|Esi0065_0090}} | |
− | + | {{#set: reaction associated=L-GLN-FRUCT-6-P-AMINOTRANS-RXN}} | |
− | + | {{#set: pathway associated=UDPNACETYLGALSYN-PWY|PWY-6749|UDPNAGSYN-PWY}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:02, 21 March 2018
Gene Ec-22_000810
- left end position:
- 948281
- transcription direction:
- POSITIVE
- right end position:
- 960911
- centisome position:
- 20.998943
- Synonym(s):
- Esi_0065_0090
- Esi0065_0090
Reactions associated
- Reaction: L-GLN-FRUCT-6-P-AMINOTRANS-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome