Difference between revisions of "CPD0-2105"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7269 PWY-7269] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] == * smiles: ** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7269 PWY-7269] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J
 
* common name:
 
* common name:
** NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast)
+
** 3-oxododecanoyl-CoA
 +
* molecular weight:
 +
** 959.791   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxolauroyl-CoA
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''4''' reactions found over '''5''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[ALDEHYDE-DEHYDROGENASE-NADP+-RXN]]
+
== Reaction(s) of unknown directionality ==
** 1 associated gene(s):
+
* [[RXN-14274]]
*** [[Ec-11_002450]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
* [[ALDHDEHYDROG-RXN]]
+
** 1 associated gene(s):
+
*** [[Ec-11_002450]]
+
** 1 reconstruction source(s) associated:
+
*** [[orthology-aragem]]
+
* [[NAD-KIN-RXN]]
+
** 3 associated gene(s):
+
*** [[Ec-08_006010]]
+
*** [[Ec-18_003910]]
+
*** [[Ec-22_000250]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
* [[RXN0-5330]]
+
** 3 associated gene(s):
+
*** [[Ec-18_003900]]
+
*** [[Ec-05_005740]]
+
*** [[Ec-02_006350]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=NADH-KINASE-RXN NADH-KINASE-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-4751}}
+
* LIGAND-CPD:
{{#set: common name=NAD/NADP-NADH/NADPH mitochondrial interconversion (yeast)}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05263 C05263]
{{#set: reaction found=4}}
+
* CHEBI:
{{#set: total reaction=5}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62615 62615]
{{#set: completion rate=80.0}}
+
* BIGG : 45453
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173506 46173506]
 +
* HMDB : HMDB03937
 +
{{#set: smiles=CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: inchi key=InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J}}
 +
{{#set: common name=3-oxododecanoyl-CoA}}
 +
{{#set: molecular weight=959.791    }}
 +
{{#set: common name=3-oxolauroyl-CoA}}
 +
{{#set: reversible reaction associated=RXN-14274}}

Latest revision as of 19:06, 21 March 2018

Metabolite CPD0-2105

  • smiles:
    • CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J
  • common name:
    • 3-oxododecanoyl-CoA
  • molecular weight:
    • 959.791
  • Synonym(s):
    • 3-oxolauroyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.