Difference between revisions of "CPD-15566"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carboxylic-esters Carboxylic-esters] == * common name: ** a carboxylic ester * Synonym(s): ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] == * smiles: ** CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] == |
+ | * smiles: | ||
+ | ** CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=ULOGSHZMDLRQRY-INBGBNCRSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 2-trans,4-trans-tetradecadienoyl-CoA |
+ | * molecular weight: | ||
+ | ** 969.83 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14715]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659084 90659084] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87712 87712] | ||
+ | {{#set: smiles=CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=ULOGSHZMDLRQRY-INBGBNCRSA-J}} | ||
+ | {{#set: common name=2-trans,4-trans-tetradecadienoyl-CoA}} | ||
+ | {{#set: molecular weight=969.83 }} | ||
+ | {{#set: consumed by=RXN-14715}} |
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CPD-15566
- smiles:
- CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=ULOGSHZMDLRQRY-INBGBNCRSA-J
- common name:
- 2-trans,4-trans-tetradecadienoyl-CoA
- molecular weight:
- 969.83
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.