Difference between revisions of "RXN-13883"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] == * smiles: ** C1(C=C(C=CC=1C3(OC2(=CC(=CC=C2C(C3)=O)O)))O) * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13883 RXN-13883] == * direction: ** LEFT-TO-RIGHT * common name: ** Fatty acid hydroxylase * ec...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13883 RXN-13883] ==
−
* smiles:
+
* direction:
−
** C1(C=C(C=CC=1C3(OC2(=CC(=CC=C2C(C3)=O)O)))O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=FURUXTVZLHCCNA-AWEZNQCLSA-N
+
 
* common name:
 
* common name:
−
** (2S)-liquiritigenin
+
** Fatty acid hydroxylase
−
* molecular weight:
+
* ec number:
−
** 256.257   
+
** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20]
 
* Synonym(s):
 
* Synonym(s):
−
** 4',7-dihydroxyflavanone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-3221]]
+
** 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-14893]][c] '''+''' 2 [[PROTON]][c] '''=>''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 1 [[CPD-14894]][c] '''+''' 2 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2 a ferrocytochrome b5[c] '''+''' 1 oxygen[c] '''+''' 1 ergost-7-enol[c] '''+''' 2 H+[c] '''=>''' 2 a ferricytochrome b5[c] '''+''' 1 ergosta-5,7-dienol[c] '''+''' 2 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_003780]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7154]], ergosterol biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7154 PWY-7154]
 +
** '''2''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB03601
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=Fatty acid hydroxylase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=114829 114829]
+
{{#set: ec number=EC-1.14.19.20}}
−
* HMDB : HMDB29519
+
{{#set: gene associated=Ec-01_003780}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7154}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C09762 C09762]
+
{{#set: reconstruction category=annotation}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.chemspider.com/Chemical-Structure.102790.html 102790]
+
{{#set: reconstruction tool=pathwaytools}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28777 28777]
+
−
* METABOLIGHTS : MTBLC28777
+
−
{{#set: smiles=C1(C=C(C=CC=1C3(OC2(=CC(=CC=C2C(C3)=O)O)))O)}}
+
−
{{#set: inchi key=InChIKey=FURUXTVZLHCCNA-AWEZNQCLSA-N}}
+
−
{{#set: common name=(2S)-liquiritigenin}}
+
−
{{#set: molecular weight=256.257    }}
+
−
{{#set: common name=4',7-dihydroxyflavanone}}
+
−
{{#set: produced by=RXN-3221}}
+

Latest revision as of 19:11, 21 March 2018

Reaction RXN-13883

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Fatty acid hydroxylase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7154, ergosterol biosynthesis II: PWY-7154
    • 2 reactions found over 8 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-13883&oldid=25171"