Difference between revisions of "PWY-5514"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * inchi key: ** InChIKey=J...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5514 PWY-5514] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-68459 TAX-6...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5514 PWY-5514] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-68459 TAX-68459] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** UDP-N-acetyl-D-galactosamine biosynthesis II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''5''' reactions found over '''7''' reactions in the full pathway |
| − | + | * [[GLUCOKIN-RXN]] | |
| − | * [[ | + | ** 1 associated gene(s): |
| − | == Reaction(s) | + | *** [[Ec-27_005030]] |
| − | * [ | + | ** 1 reconstruction source(s) associated: |
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[GLUCOSAMINEPNACETYLTRANS-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[NAG1P-URIDYLTRANS-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-23_002570]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | * [[PGLUCISOM-RXN]] | ||
| + | ** 3 associated gene(s): | ||
| + | *** [[Ec-24_002470]] | ||
| + | *** [[Ec-13_003530]] | ||
| + | *** [[Ec-13_003810]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-10_005030]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINE-6-P-DEAMIN-RXN GLUCOSAMINE-6-P-DEAMIN-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-68459}} | |
| − | + | {{#set: common name=UDP-N-acetyl-D-galactosamine biosynthesis II}} | |
| − | + | {{#set: reaction found=5}} | |
| − | + | {{#set: total reaction=7}} | |
| − | + | {{#set: completion rate=71.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:28, 21 March 2018
Pathway PWY-5514
- taxonomic range:
- common name:
- UDP-N-acetyl-D-galactosamine biosynthesis II
- Synonym(s):
Reaction(s) found
5 reactions found over 7 reactions in the full pathway
- GLUCOKIN-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- GLUCOSAMINEPNACETYLTRANS-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- NAG1P-URIDYLTRANS-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- PGLUCISOM-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- PHOSACETYLGLUCOSAMINEMUT-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
