Difference between revisions of "DCMP"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=KETOISOCAPROATE-RXN KETOISOCAPROATE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-methy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCMP DCMP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O * inchi key: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCMP DCMP] == |
− | * | + | * smiles: |
− | ** | + | ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=NCMVOABPESMRCP-SHYZEUOFSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** dCMP |
− | * | + | * molecular weight: |
− | + | ** 305.183 | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2'-deoxycytidine 5'-monophosphate | ||
+ | ** deoxycytidylate | ||
+ | ** deoxycytidylic acid | ||
+ | ** deoxycytidine monophosphate | ||
+ | ** 2'-deoxycytidine 5'-phosphate | ||
+ | ** deoxycytidine-phosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-7913]] |
− | + | * [[DCMP-DEAMINASE-RXN]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-14187]] | |
− | + | * [[RXN-14198]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | * | + | |
− | * | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 1032-65-1 |
− | * | + | * BIGG : 34352 |
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7058169 7058169] |
− | + | * HMDB : HMDB01202 | |
− | + | * LIGAND-CPD: | |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00239 C00239] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.5414501.html 5414501] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57566 57566] |
− | + | * METABOLIGHTS : MTBLC57566 | |
− | * | + | {{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O}} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=NCMVOABPESMRCP-SHYZEUOFSA-L}} |
− | + | {{#set: common name=dCMP}} | |
− | + | {{#set: molecular weight=305.183 }} | |
− | * | + | {{#set: common name=2'-deoxycytidine 5'-monophosphate|deoxycytidylate|deoxycytidylic acid|deoxycytidine monophosphate|2'-deoxycytidine 5'-phosphate|deoxycytidine-phosphate}} |
− | + | {{#set: consumed by=RXN-7913|DCMP-DEAMINASE-RXN}} | |
− | + | {{#set: produced by=RXN-14187|RXN-14198}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:35, 21 March 2018
Contents
Metabolite DCMP
- smiles:
- C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O
- inchi key:
- InChIKey=NCMVOABPESMRCP-SHYZEUOFSA-L
- common name:
- dCMP
- molecular weight:
- 305.183
- Synonym(s):
- 2'-deoxycytidine 5'-monophosphate
- deoxycytidylate
- deoxycytidylic acid
- deoxycytidine monophosphate
- 2'-deoxycytidine 5'-phosphate
- deoxycytidine-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 1032-65-1
- BIGG : 34352
- PUBCHEM:
- HMDB : HMDB01202
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57566
"C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.