Difference between revisions of "RXN-9230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LANOSTEROL LANOSTEROL] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9230 RXN-9230] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-hydroxybenzoate nonaprenylt...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LANOSTEROL LANOSTEROL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9230 RXN-9230] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=CAHGCLMLTWQZNJ-BQNIITSRSA-N
+
 
* common name:
 
* common name:
−
** lanosterol
+
** 4-hydroxybenzoate nonaprenyltransferase
−
* molecular weight:
+
* ec number:
−
** 426.724   
+
** [http://enzyme.expasy.org/EC/2.5.1.39 EC-2.5.1.39]
 
* Synonym(s):
 
* Synonym(s):
−
** 4,4,14α-trimethyl-5α-cholesta-8,24-dien-3β-ol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN3O-130]]
+
* With identifiers:
−
* [[RXN66-303]]
+
** 1 [[4-hydroxybenzoate]][c] '''+''' 1 [[CPD-9610]][c] '''=>''' 1 [[CPD-9864]][c] '''+''' 1 [[PPI]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 4-hydroxybenzoate[c] '''+''' 1 all-trans-decaprenyl diphosphate[c] '''=>''' 1 3-decaprenyl-4-hydroxybenzoate[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-00_007360]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-5872]], ubiquinol-10 biosynthesis (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5872 PWY-5872]
 +
** '''1''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-5857]], ubiquinol-10 biosynthesis (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5857 PWY-5857]
 +
** '''1''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 79-63-0
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* DRUGBANK : DB03696
+
{{#set: common name=4-hydroxybenzoate nonaprenyltransferase}}
−
* PUBCHEM:
+
{{#set: ec number=EC-2.5.1.39}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=246983 246983]
+
{{#set: gene associated=Ec-00_007360}}
−
* HMDB : HMDB01251
+
{{#set: in pathway=PWY-5872|PWY-5857}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01724 C01724]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16521 16521]
+
−
* METABOLIGHTS : MTBLC16521
+
−
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
−
{{#set: inchi key=InChIKey=CAHGCLMLTWQZNJ-BQNIITSRSA-N}}
+
−
{{#set: common name=lanosterol}}
+
−
{{#set: molecular weight=426.724    }}
+
−
{{#set: common name=4,4,14α-trimethyl-5α-cholesta-8,24-dien-3β-ol}}
+
−
{{#set: consumed by=RXN3O-130|RXN66-303}}
+

Latest revision as of 19:16, 21 March 2018

Reaction RXN-9230

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 4-hydroxybenzoate nonaprenyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 4-hydroxybenzoate[c] + 1 all-trans-decaprenyl diphosphate[c] => 1 3-decaprenyl-4-hydroxybenzoate[c] + 1 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5872, ubiquinol-10 biosynthesis (eukaryotic): PWY-5872
    • 1 reactions found over 9 reactions in the full pathway
  • PWY-5857, ubiquinol-10 biosynthesis (prokaryotic): PWY-5857
    • 1 reactions found over 8 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-9230&oldid=25764"