Difference between revisions of "SIROHYDROCHLORIN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE-SYNTHASE-RXN CHORISMATE-SYNTHASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] == * smiles: ** CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SIROHYDROCHLORIN SIROHYDROCHLORIN] == |
− | * | + | * smiles: |
− | ** | + | ** CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5))) |
+ | * inchi key: | ||
+ | ** InChIKey=KWIZRXMMFRBUML-AHGFGAHVSA-F | ||
* common name: | * common name: | ||
− | ** | + | ** sirohydrochlorin |
− | * | + | * molecular weight: |
− | ** | + | ** 854.779 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Precorrin | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[4.99.1.3-RXN]] | |
− | + | * [[SIROHEME-FERROCHELAT-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 65207-12-7 |
− | ** [http:// | + | * PUBCHEM: |
− | * | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245154 25245154] |
− | ** [http://www. | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58351 58351] | |
− | + | * BIGG : 46482 | |
− | + | * LIGAND-CPD: | |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05778 C05778] |
− | * | + | {{#set: smiles=CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5)))}} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=KWIZRXMMFRBUML-AHGFGAHVSA-F}} |
− | + | {{#set: common name=sirohydrochlorin}} | |
− | + | {{#set: molecular weight=854.779 }} | |
− | + | {{#set: common name=Precorrin}} | |
− | + | {{#set: consumed by=4.99.1.3-RXN|SIROHEME-FERROCHELAT-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:47, 21 March 2018
Contents
Metabolite SIROHYDROCHLORIN
- smiles:
- CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5)))
- inchi key:
- InChIKey=KWIZRXMMFRBUML-AHGFGAHVSA-F
- common name:
- sirohydrochlorin
- molecular weight:
- 854.779
- Synonym(s):
- Precorrin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC2(CC(=O)[O-])(C1(=CC5(=NC(=CC4(NC(C=C3(N=C(C=C(N1)C(CCC(=O)[O-])2)C(CC(=O)[O-])=C(CCC(=O)[O-])3))=C(CCC(=O)[O-])C(CC(=O)[O-])=4))C(C)(CC(=O)[O-])C(CCC(=O)[O-])5)))" cannot be used as a page name in this wiki.