Difference between revisions of "CPD-19162"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_000990 == * left end position: ** 983925 * transcription direction: ** POSITIVE * right end position: ** 986715 * centisome position: ** 14.997...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19162 CPD-19162] == * smiles: ** CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19162 CPD-19162] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J |
| − | * | + | * common name: |
| − | ** | + | ** (2E,9Z)-hexadecenoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 997.883 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 16:2-Δ2,Δ9-CoA |
| − | ** | + | ** 2-trans,9-cis-hexadecenoyl-CoA |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-17789]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-17788]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J}} |
| − | {{#set: | + | {{#set: common name=(2E,9Z)-hexadecenoyl-CoA}} |
| − | {{#set: | + | {{#set: molecular weight=997.883 }} |
| − | {{#set: common name= | + | {{#set: common name=16:2-Δ2,Δ9-CoA|2-trans,9-cis-hexadecenoyl-CoA}} |
| − | {{#set: | + | {{#set: consumed by=RXN-17789}} |
| + | {{#set: produced by=RXN-17788}} | ||
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD-19162
- smiles:
- CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=BEQWCBBSKHMRCA-HENMZMGOSA-J
- common name:
- (2E,9Z)-hexadecenoyl-CoA
- molecular weight:
- 997.883
- Synonym(s):
- 16:2-Δ2,Δ9-CoA
- 2-trans,9-cis-hexadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
