Difference between revisions of "S-ADENOSYLMETHIONINAMINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VAL-tRNAs VAL-tRNAs] == * common name: ** a tRNAval * Synonym(s): ** TRNA(VAL) == Reaction(s)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINAMINE S-ADENOSYLMETHIONINAMINE] == * smiles: ** C[S+](CCC[N+])CC1(OC(C(O)C(O...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYLMETHIONINAMINE S-ADENOSYLMETHIONINAMINE] == |
+ | * smiles: | ||
+ | ** C[S+](CCC[N+])CC1(OC(C(O)C(O)1)N3(C=NC2(=C(N)N=CN=C23))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZUNBITIXDCPNSD-LSRJEVITSA-O | ||
* common name: | * common name: | ||
− | ** | + | ** S-adenosyl 3-(methylthio)propylamine |
+ | * molecular weight: | ||
+ | ** 356.442 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** S-adenosyl-(5')-3-methylthiopropylamine |
+ | ** dcSAM | ||
+ | ** decarboxylated AdoMet | ||
+ | ** (5-deoxy-5-adenosyl)(3-aminopropyl) methylsulfonium salt | ||
+ | ** decarboxylated SAM | ||
+ | ** S-adenosylmethioninamine | ||
+ | ** decarboxylated S-adenosylmethionine | ||
+ | ** dAdoMet | ||
+ | ** S-methyl-S-adenosyl homocysteamine | ||
+ | ** 3-amino-propyl-S-adenosine | ||
+ | ** S-adenosyl-L-methioninamine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[SPERMINE-SYNTHASE-RXN]] |
+ | * [[RXN0-5217]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[SAMDECARB-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[SPERMIDINESYN-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * BIGG : 36895 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203490 25203490] |
+ | * HMDB : HMDB00988 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01137 C01137] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57443 57443] | ||
+ | * METABOLIGHTS : MTBLC57443 | ||
+ | {{#set: smiles=C[S+](CCC[N+])CC1(OC(C(O)C(O)1)N3(C=NC2(=C(N)N=CN=C23)))}} | ||
+ | {{#set: inchi key=InChIKey=ZUNBITIXDCPNSD-LSRJEVITSA-O}} | ||
+ | {{#set: common name=S-adenosyl 3-(methylthio)propylamine}} | ||
+ | {{#set: molecular weight=356.442 }} | ||
+ | {{#set: common name=S-adenosyl-(5')-3-methylthiopropylamine|dcSAM|decarboxylated AdoMet|(5-deoxy-5-adenosyl)(3-aminopropyl) methylsulfonium salt|decarboxylated SAM|S-adenosylmethioninamine|decarboxylated S-adenosylmethionine|dAdoMet|S-methyl-S-adenosyl homocysteamine|3-amino-propyl-S-adenosine|S-adenosyl-L-methioninamine}} | ||
+ | {{#set: consumed by=SPERMINE-SYNTHASE-RXN|RXN0-5217}} | ||
+ | {{#set: produced by=SAMDECARB-RXN}} | ||
+ | {{#set: reversible reaction associated=SPERMIDINESYN-RXN}} |
Latest revision as of 19:17, 21 March 2018
Contents
Metabolite S-ADENOSYLMETHIONINAMINE
- smiles:
- C[S+](CCC[N+])CC1(OC(C(O)C(O)1)N3(C=NC2(=C(N)N=CN=C23)))
- inchi key:
- InChIKey=ZUNBITIXDCPNSD-LSRJEVITSA-O
- common name:
- S-adenosyl 3-(methylthio)propylamine
- molecular weight:
- 356.442
- Synonym(s):
- S-adenosyl-(5')-3-methylthiopropylamine
- dcSAM
- decarboxylated AdoMet
- (5-deoxy-5-adenosyl)(3-aminopropyl) methylsulfonium salt
- decarboxylated SAM
- S-adenosylmethioninamine
- decarboxylated S-adenosylmethionine
- dAdoMet
- S-methyl-S-adenosyl homocysteamine
- 3-amino-propyl-S-adenosine
- S-adenosyl-L-methioninamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 36895
- PUBCHEM:
- HMDB : HMDB00988
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57443
"C[S+](CCC[N+])CC1(OC(C(O)C(O)1)N3(C=NC2(=C(N)N=CN=C23)))" cannot be used as a page name in this wiki.