Difference between revisions of "CPD-14375"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) * in...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14375 CPD-14375] == * common name: ** a glycopeptide-D-mannosyl-N4-N-acetyl-D-glucosamine *...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14375 CPD-14375] ==
* smiles:
+
** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)
+
* inchi key:
+
** InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M
+
 
* common name:
 
* common name:
** (2S)-eriodictyol
+
** a glycopeptide-D-mannosyl-N4-N-acetyl-D-glucosamine
* molecular weight:
+
** 287.248   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7775]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.2.1.96-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a glycopeptide-D-mannosyl-N4-N-acetyl-D-glucosamine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657147 90657147]
+
{{#set: produced by=3.2.1.96-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28412 28412]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05631 C05631]
+
* HMDB : HMDB05810
+
{{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)}}
+
{{#set: inchi key=InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M}}
+
{{#set: common name=(2S)-eriodictyol}}
+
{{#set: molecular weight=287.248    }}
+
{{#set: consumed by=RXN-7775}}
+

Latest revision as of 19:56, 21 March 2018

Metabolite CPD-14375

  • common name:
    • a glycopeptide-D-mannosyl-N4-N-acetyl-D-glucosamine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links