Difference between revisions of "CPD-11407"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-06_001850 == * Synonym(s): ** Esi_0141_0059 ** Esi0141_0059 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == * smiles: ** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == |
| + | * smiles: | ||
| + | ** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I) | ||
| + | * inchi key: | ||
| + | ** InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M | ||
| + | * common name: | ||
| + | ** thyroxine sulfate | ||
| + | * molecular weight: | ||
| + | ** 855.924 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** T4 sulfate |
| − | ** | + | ** thyroxine-4-sulfate |
| + | ** L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo- | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-10614]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657726 90657726] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58910 58910] | ||
| + | {{#set: smiles=C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)}} | ||
| + | {{#set: inchi key=InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M}} | ||
| + | {{#set: common name=thyroxine sulfate}} | ||
| + | {{#set: molecular weight=855.924 }} | ||
| + | {{#set: common name=T4 sulfate|thyroxine-4-sulfate|L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-}} | ||
| + | {{#set: produced by=RXN-10614}} | ||
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite CPD-11407
- smiles:
- C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)
- inchi key:
- InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M
- common name:
- thyroxine sulfate
- molecular weight:
- 855.924
- Synonym(s):
- T4 sulfate
- thyroxine-4-sulfate
- L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)" cannot be used as a page name in this wiki.
