Difference between revisions of "RXN-15139"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRECURSOR-Z PRECURSOR-Z] == * smiles: ** C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15139 RXN-15139] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRECURSOR-Z PRECURSOR-Z] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15139 RXN-15139] ==
* smiles:
+
* direction:
** C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(N)NC(=O)4))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=PWFXLXMPGSLEOZ-QQVWSJFJSA-M
+
* common name:
+
** cyclic pyranopterin phosphate
+
* molecular weight:
+
** 344.2   
+
 
* Synonym(s):
 
* Synonym(s):
** precursor Z
 
** cPMP
 
** precursor-Z
 
** 8-amino-2,12,12-trihydroxy-4a,5a,6,9,11,11a,12,12a-octahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-10(4H)-one 2-oxide
 
** 8-amino-2,12,12-trihydroxy-4,4a,5a,6,9,10,11,11a,12,12a-decahydro-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine 2-oxide
 
** cyclic pyranopterin monophosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-8342]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 2 [[CPD-12377]][c] '''+''' 1 [[ADENINE]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD0-2461]][c]
* [[RXN-8340]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 2 hydroxyl radical[c] '''+''' 1 adenine[c] '''=>''' 1 H2O[c] '''+''' 1 isoguanine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659039 90659039]
+
{{#set: in pathway=}}
* CHEBI:
+
{{#set: reconstruction category=annotation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59648 59648]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: smiles=C1(OP([O-])(=O)OC2(C1O[CH]3([CH](C(=O)2)NC4(=C(N3)N=C(N)NC(=O)4))))}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: inchi key=InChIKey=PWFXLXMPGSLEOZ-QQVWSJFJSA-M}}
+
{{#set: common name=cyclic pyranopterin phosphate}}
+
{{#set: molecular weight=344.2    }}
+
{{#set: common name=precursor Z|cPMP|precursor-Z|8-amino-2,12,12-trihydroxy-4a,5a,6,9,11,11a,12,12a-octahydro[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-10(4H)-one 2-oxide|8-amino-2,12,12-trihydroxy-4,4a,5a,6,9,10,11,11a,12,12a-decahydro-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridine 2-oxide|cyclic pyranopterin monophosphate}}
+
{{#set: consumed by=RXN-8342}}
+
{{#set: produced by=RXN-8340}}
+

Latest revision as of 19:57, 21 March 2018

Reaction RXN-15139

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2 hydroxyl radical[c] + 1 adenine[c] => 1 H2O[c] + 1 isoguanine[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links