Difference between revisions of "Ec-07 001830"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] == * smiles: ** C12(NC(=O)NC(C=1N=CN2)=O) * inchi key: ** InChIKey=LRFVTYWOQ...") |
(Created page with "Category:Gene == Gene Ec-07_001830 == * left end position: ** 1984710 * transcription direction: ** NEGATIVE * right end position: ** 1993227 * centisome position: ** 25.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-07_001830 == |
− | * | + | * left end position: |
− | ** | + | ** 1984710 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1993227 |
− | * | + | * centisome position: |
− | ** | + | ** 25.70059 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0061_0007 |
+ | ** Esi0061_0007 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.4.11.18-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | == | + | == Pathways associated == |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1984710}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1993227}} | |
− | + | {{#set: centisome position=25.70059 }} | |
− | + | {{#set: common name=Esi_0061_0007|Esi0061_0007}} | |
− | + | {{#set: reaction associated=3.4.11.18-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:58, 21 March 2018
Gene Ec-07_001830
- left end position:
- 1984710
- transcription direction:
- NEGATIVE
- right end position:
- 1993227
- centisome position:
- 25.70059
- Synonym(s):
- Esi_0061_0007
- Esi0061_0007
Reactions associated
- Reaction: 3.4.11.18-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome