Difference between revisions of "RXN-7664"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] == * smiles: ** C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O * inchi key: ** InC...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7664 RXN-7664] == * direction: ** LEFT-TO-RIGHT * common name: ** Geranylgeranyl reductase * Sy...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7664 RXN-7664] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Geranylgeranyl reductase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[CPD-7005]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-7004]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 geranylgeranyl chlorophyll a[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 dihydrogeranylgeranyl chlorophyll a[c] |
| − | * [[ | + | |
| − | == | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[Ec-03_003520]] |
| − | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-5064]], chlorophyll a biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064] | ||
| + | ** '''3''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=Geranylgeranyl reductase}} | |
| − | + | {{#set: gene associated=Ec-03_003520}} | |
| − | + | {{#set: in pathway=PWY-5064}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:19, 21 March 2018
Contents
Reaction RXN-7664
- direction:
- LEFT-TO-RIGHT
- common name:
- Geranylgeranyl reductase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 geranylgeranyl chlorophyll a[c] + 1 NADPH[c] + 1 H+[c] => 1 NADP+[c] + 1 dihydrogeranylgeranyl chlorophyll a[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-03_003520
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-5064, chlorophyll a biosynthesis II: PWY-5064
- 3 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
