Difference between revisions of "Ec-19 003370"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([...")
 
(Created page with "Category:Gene == Gene Ec-19_003370 == * left end position: ** 3632531 * transcription direction: ** POSITIVE * right end position: ** 3636584 * centisome position: ** 60.8...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] ==
+
== Gene Ec-19_003370 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
+
** 3632531
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
+
** 3636584
−
* molecular weight:
+
* centisome position:
−
** 443.688    
+
** 60.8394    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0402_0019
 +
** Esi0402_0019
 +
** Pdi6
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-18]]
+
* Reaction: [[5.3.4.1-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[DISULISOM-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3632531}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202943 25202943]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB12165
+
{{#set: right end position=3636584}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}}
+
{{#set: centisome position=60.8394    }}
−
{{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}}
+
{{#set: common name=Esi_0402_0019|Esi0402_0019|Pdi6}}
−
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: reaction associated=5.3.4.1-RXN|DISULISOM-RXN}}
−
{{#set: molecular weight=443.688    }}
+
−
{{#set: consumed by=RXN66-18}}
+

Latest revision as of 19:21, 21 March 2018

Gene Ec-19_003370

  • left end position:
    • 3632531
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3636584
  • centisome position:
    • 60.8394
  • Synonym(s):
    • Esi_0402_0019
    • Esi0402_0019
    • Pdi6

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_003370&oldid=26337"