Difference between revisions of "PWY-6519"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-NITROPHENOL P-NITROPHENOL] == * smiles: ** C1(C=C([O-])C=CC=1[N+](=O)[O-]) * inchi key: ** In...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 8-amino-7-oxononanoate biosynthesis I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 7-keto-8-aminopelargonate biosynthesis I |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''7''' reactions found over '''11''' reactions in the full pathway | |
− | * [[ | + | * [[RXN-11474]] |
− | * [[4- | + | ** 4 associated gene(s): |
− | * [[RXN- | + | *** [[Ec-12_000650]] |
− | * [[RXN- | + | *** [[Ec-12_000640]] |
− | == Reaction(s) | + | *** [[Ec-27_003480]] |
+ | *** [[Ec-27_002090]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-11476]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_007100]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-11478]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-27_002470]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-11479]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-12_000650]] | ||
+ | *** [[Ec-27_003480]] | ||
+ | *** [[Ec-27_002090]] | ||
+ | *** [[Ec-12_000640]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-11480]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_007100]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-11482]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-27_002470]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-11484]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-04_002200]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11475 RXN-11475] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11477 RXN-11477] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11481 RXN-11481] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11483 RXN-11483] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6519 PWY-6519] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2}} |
− | + | {{#set: common name=8-amino-7-oxononanoate biosynthesis I}} | |
− | + | {{#set: common name=7-keto-8-aminopelargonate biosynthesis I}} | |
− | + | {{#set: reaction found=7}} | |
− | + | {{#set: total reaction=11}} | |
− | + | {{#set: completion rate=64.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:27, 21 March 2018
Pathway PWY-6519
- taxonomic range:
- common name:
- 8-amino-7-oxononanoate biosynthesis I
- Synonym(s):
- 7-keto-8-aminopelargonate biosynthesis I
Reaction(s) found
7 reactions found over 11 reactions in the full pathway
- RXN-11474
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11476
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11478
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11479
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11480
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11482
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11484
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: