Difference between revisions of "PWY-6519"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-NITROPHENOL P-NITROPHENOL] == * smiles: ** C1(C=C([O-])C=CC=1[N+](=O)[O-]) * inchi key: ** In...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-NITROPHENOL P-NITROPHENOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519] ==
−
* smiles:
+
* taxonomic range:
−
** C1(C=C([O-])C=CC=1[N+](=O)[O-])
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=BTJIUGUIPKRLHP-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 4-nitrophenol
+
** 8-amino-7-oxononanoate biosynthesis I
−
* molecular weight:
+
−
** 138.102   
+
 
* Synonym(s):
 
* Synonym(s):
−
** p-nitrophenol
+
** 7-keto-8-aminopelargonate biosynthesis I
−
** PNP
+
−
** niphen
+
−
** 4-hydroxynitrobenzene
+
−
** para-nitrophenol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''7''' reactions found over '''11''' reactions in the full pathway
−
* [[ARYLDIALKYL-PHOSPHATASE-RXN]]
+
* [[RXN-11474]]
−
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
** 4 associated gene(s):
−
* [[RXN-8746]]
+
*** [[Ec-12_000650]]
−
* [[RXN-8743]]
+
*** [[Ec-12_000640]]
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-27_003480]]
 +
*** [[Ec-27_002090]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11476]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11478]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11479]]
 +
** 4 associated gene(s):
 +
*** [[Ec-12_000650]]
 +
*** [[Ec-27_003480]]
 +
*** [[Ec-27_002090]]
 +
*** [[Ec-12_000640]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11480]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11482]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11484]]
 +
** 1 associated gene(s):
 +
*** [[Ec-04_002200]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11475 RXN-11475]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11477 RXN-11477]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11481 RXN-11481]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11483 RXN-11483]
 
== External links  ==
 
== External links  ==
−
* CAS : 100-02-7
+
* ECOCYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6519 PWY-6519]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=644235 644235]
+
{{#set: taxonomic range=TAX-2}}
−
* HMDB : HMDB01232
+
{{#set: common name=8-amino-7-oxononanoate biosynthesis I}}
−
* LIGAND-CPD:
+
{{#set: common name=7-keto-8-aminopelargonate biosynthesis I}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00870 C00870]
+
{{#set: reaction found=7}}
−
* CHEMSPIDER:
+
{{#set: total reaction=11}}
−
** [http://www.chemspider.com/Chemical-Structure.559254.html 559254]
+
{{#set: completion rate=64.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57917 57917]
+
−
* METABOLIGHTS : MTBLC57917
+
−
{{#set: smiles=C1(C=C([O-])C=CC=1[N+](=O)[O-])}}
+
−
{{#set: inchi key=InChIKey=BTJIUGUIPKRLHP-UHFFFAOYSA-M}}
+
−
{{#set: common name=4-nitrophenol}}
+
−
{{#set: molecular weight=138.102    }}
+
−
{{#set: common name=p-nitrophenol|PNP|niphen|4-hydroxynitrobenzene|para-nitrophenol}}
+
−
{{#set: produced by=ARYLDIALKYL-PHOSPHATASE-RXN|4-NITROPHENYLPHOSPHATASE-RXN|RXN-8746|RXN-8743}}
+

Latest revision as of 19:27, 21 March 2018

Pathway PWY-6519

  • taxonomic range:
  • common name:
    • 8-amino-7-oxononanoate biosynthesis I
  • Synonym(s):
    • 7-keto-8-aminopelargonate biosynthesis I

Reaction(s) found

7 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6519&oldid=27052"