Difference between revisions of "PWY-5514"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] == * smiles: ** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5514 PWY-5514] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-68459 TAX-6...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5514 PWY-5514] ==
* smiles:
+
* taxonomic range:
** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-68459 TAX-68459]
* inchi key:
+
** InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J
+
 
* common name:
 
* common name:
** (2E,11Z)-hexadec-2,11-dienoyl-CoA
+
** UDP-N-acetyl-D-galactosamine biosynthesis II
* molecular weight:
+
** 997.883   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-16558]]
+
'''5''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[GLUCOKIN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-27_005030]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[GLUCOSAMINEPNACETYLTRANS-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[NAG1P-URIDYLTRANS-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-23_002570]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PGLUCISOM-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-24_002470]]
 +
*** [[Ec-13_003530]]
 +
*** [[Ec-13_003810]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-10_005030]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINE-6-P-DEAMIN-RXN GLUCOSAMINE-6-P-DEAMIN-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-68459}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819958 91819958]
+
{{#set: common name=UDP-N-acetyl-D-galactosamine biosynthesis II}}
{{#set: smiles=CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}}
+
{{#set: reaction found=5}}
{{#set: inchi key=InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J}}
+
{{#set: total reaction=7}}
{{#set: common name=(2E,11Z)-hexadec-2,11-dienoyl-CoA}}
+
{{#set: completion rate=71.0}}
{{#set: molecular weight=997.883    }}
+
{{#set: consumed by=RXN-16558}}
+

Latest revision as of 19:28, 21 March 2018

Pathway PWY-5514

  • taxonomic range:
  • common name:
    • UDP-N-acetyl-D-galactosamine biosynthesis II
  • Synonym(s):

Reaction(s) found

5 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links