Difference between revisions of "L-SELENOCYSTEINE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12978 RXN-12978] == * direction: ** LEFT-TO-RIGHT * common name: ** long chain acyl-CoA synthet...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] == * smiles: ** C([Se])C([N+])C([O-])=O * inchi key: ** InCh...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C([Se])C([N+])C([O-])=O |
| + | * inchi key: | ||
| + | ** InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** L-selenocysteine |
| − | * | + | * molecular weight: |
| − | + | ** 168.054 | |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| + | ** U | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-12726]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05688 C05688] | |
| − | + | * CHEBI: | |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57843 57843] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC57843 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245418 25245418] |
| − | {{#set: | + | * HMDB : HMDB03288 |
| − | {{#set: | + | {{#set: smiles=C([Se])C([N+])C([O-])=O}} |
| + | {{#set: inchi key=InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N}} | ||
| + | {{#set: common name=L-selenocysteine}} | ||
| + | {{#set: molecular weight=168.054 }} | ||
| + | {{#set: common name=U}} | ||
| + | {{#set: produced by=RXN-12726}} | ||
Latest revision as of 19:31, 21 March 2018
Contents
Metabolite L-SELENOCYSTEINE
- smiles:
- C([Se])C([N+])C([O-])=O
- inchi key:
- InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N
- common name:
- L-selenocysteine
- molecular weight:
- 168.054
- Synonym(s):
- U
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([Se])C([N+])C([O-])=O" cannot be used as a page name in this wiki.
