|
|
(2 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETOOHBUTSYN-RXN ACETOOHBUTSYN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O |
| + | * inchi key: |
| + | ** InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M |
| * common name: | | * common name: |
− | ** 2-aceto-2-hydroxy-butyrate synthase | + | ** S-sulfanylglutathione |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/2.2.1.6 EC-2.2.1.6] | + | ** 338.373 |
| * Synonym(s): | | * Synonym(s): |
| + | ** GSSH |
| + | ** glutathione-sulfide |
| + | ** glutathione persulfide |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[PYRUVATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[2-OXOBUTANOATE]][c] '''=>''' 1 [[2-ACETO-2-HYDROXY-BUTYRATE]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
| + | * [[RXN-15348]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 pyruvate[c] '''+''' 1 H+[c] '''+''' 1 2-oxobutanoate[c] '''=>''' 1 (S)-2-aceto-2-hydroxybutanoate[c] '''+''' 1 CO2[c]
| + | * [[RXN-10851]] |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | == Pathways == | + | |
− | * [[PWY-5103]], L-isoleucine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5103 PWY-5103]
| + | |
− | ** '''4''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[ILEUSYN-PWY]], L-isoleucine biosynthesis I (from threonine): [http://metacyc.org/META/NEW-IMAGE?object=ILEUSYN-PWY ILEUSYN-PWY]
| + | |
− | ** '''7''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-5101]], L-isoleucine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5101 PWY-5101]
| + | |
− | ** '''4''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-5104]], L-isoleucine biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5104 PWY-5104] | + | |
− | ** '''3''' reactions found over '''6''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[annotation]]: | + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[esiliculosus_genome]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27654 27654] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878477 46878477] |
− | * LIGAND-RXN: | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R08648 R08648] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58905 58905] |
− | * UNIPROT:
| + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/Q59950 Q59950]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C17267 C17267] |
− | ** [http://www.uniprot.org/uniprot/P42463 P42463]
| + | {{#set: smiles=C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} |
− | ** [http://www.uniprot.org/uniprot/Q8XAV3 Q8XAV3] | + | {{#set: inchi key=InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M}} |
− | ** [http://www.uniprot.org/uniprot/P27868 P27868] | + | {{#set: common name=S-sulfanylglutathione}} |
− | ** [http://www.uniprot.org/uniprot/P45260 P45260]
| + | {{#set: molecular weight=338.373 }} |
− | ** [http://www.uniprot.org/uniprot/Q57625 Q57625]
| + | {{#set: common name=GSSH|glutathione-sulfide|glutathione persulfide}} |
− | ** [http://www.uniprot.org/uniprot/P37251 P37251]
| + | {{#set: produced by=RXN-15348}} |
− | ** [http://www.uniprot.org/uniprot/P45261 P45261]
| + | {{#set: reversible reaction associated=RXN-10851}} |
− | ** [http://www.uniprot.org/uniprot/O27493 O27493]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66759 O66759]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PHU2 Q9PHU2]
| + | |
− | ** [http://www.uniprot.org/uniprot/O05031 O05031]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q57725 Q57725]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PHU1 Q9PHU1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JTI1 Q9JTI1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58077 Q58077]
| + | |
− | ** [http://www.uniprot.org/uniprot/O28554 O28554]
| + | |
− | ** [http://www.uniprot.org/uniprot/O53554 O53554]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04789 Q04789]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JRF4 Q9JRF4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59272 Q59272]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27696 P27696]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59498 Q59498]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RFQ7 Q9RFQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05767 Q05767]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40811 P40811]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21622 P21622]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27818 P27818]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41768 Q41768]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41769 Q41769]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69684 P69684]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27819 P27819]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9R586 Q9R586]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02137 Q02137]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02140 Q02140]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36620 P36620]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42767 Q42767]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42768 Q42768]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49865 Q49865]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22547 O22547]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49229 O49229]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22578 O22578]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49210 O49210]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60021 Q60021]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07342 P07342]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00892 P00892]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08142 P08142]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0ADF8 P0ADF8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00894 P00894]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00893 P00893]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17597 P17597]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09342 P09342]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09114 P09114]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14874 P14874]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=2-aceto-2-hydroxy-butyrate synthase}} | + | |
− | {{#set: ec number=EC-2.2.1.6}} | + | |
− | {{#set: in pathway=PWY-5103|ILEUSYN-PWY|PWY-5101|PWY-5104}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction tool=pathwaytools}} | + | |
− | {{#set: reconstruction source=esiliculosus_genome}}
| + | |