Difference between revisions of "CPD-13122"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13163 RXN-13163] == * direction: ** REVERSIBLE * common name: ** Aconitase/3-isopropylmalate de...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == * smiles: ** C(C1(OC(C(C(C=1)O)O)O))([O-])=O * inchi key: ** InChIKey=I...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == |
− | * | + | * smiles: |
− | ** | + | ** C(C1(OC(C(C(C=1)O)O)O))([O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 4-deoxy-L-threo-hex-4-enopyranuronate |
− | * | + | * molecular weight: |
− | ** | + | ** 175.118 |
* Synonym(s): | * Synonym(s): | ||
+ | ** (3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid | ||
+ | ** 4-deoxy-L-threo-5-hexosulose-uronic acid | ||
+ | ** 4-deoxy-L-threo-5-hexosulose-uronate | ||
+ | ** 4-deoxy-L-threo-hex-4-enopyranuronate | ||
+ | ** 4-deoxy-β-L-threo-hex-4-enopyranuronose | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-12178]] | |
− | + | * [[RXN-12270]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | * [[RXN-16475]] | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819971 91819971] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62482 62482] |
− | {{#set: | + | {{#set: smiles=C(C1(OC(C(C(C=1)O)O)O))([O-])=O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M}} |
− | {{#set: | + | {{#set: common name=4-deoxy-L-threo-hex-4-enopyranuronate}} |
− | {{#set: | + | {{#set: molecular weight=175.118 }} |
+ | {{#set: common name=(3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid|4-deoxy-L-threo-5-hexosulose-uronic acid|4-deoxy-L-threo-5-hexosulose-uronate|4-deoxy-L-threo-hex-4-enopyranuronate|4-deoxy-β-L-threo-hex-4-enopyranuronose}} | ||
+ | {{#set: produced by=RXN-12178|RXN-12270}} | ||
+ | {{#set: reversible reaction associated=RXN-16475}} |
Latest revision as of 19:02, 21 March 2018
Contents
Metabolite CPD-13122
- smiles:
- C(C1(OC(C(C(C=1)O)O)O))([O-])=O
- inchi key:
- InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M
- common name:
- 4-deoxy-L-threo-hex-4-enopyranuronate
- molecular weight:
- 175.118
- Synonym(s):
- (3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid
- 4-deoxy-L-threo-5-hexosulose-uronic acid
- 4-deoxy-L-threo-5-hexosulose-uronate
- 4-deoxy-L-threo-hex-4-enopyranuronate
- 4-deoxy-β-L-threo-hex-4-enopyranuronose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C=1)O)O)O))([O-])=O" cannot be used as a page name in this wiki.