Difference between revisions of "CPD-12897"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19150 CPD-19150] == * smiles: ** CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] == * smiles: ** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J |
* common name: | * common name: | ||
− | ** | + | ** 7-methyl-3-oxooct-6-enoyl-CoA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 915.695 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 7-methyl-3-oxo-6-octenoyl-CoA |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11917]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: smiles= | + | * PUBCHEM: |
− | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986200 50986200] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71410 71410] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: consumed by=RXN- | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16466 C16466] |
− | + | * HMDB : HMDB60421 | |
+ | {{#set: smiles=CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J}} | ||
+ | {{#set: common name=7-methyl-3-oxooct-6-enoyl-CoA}} | ||
+ | {{#set: molecular weight=915.695 }} | ||
+ | {{#set: common name=7-methyl-3-oxo-6-octenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-11917}} |
Latest revision as of 19:40, 21 March 2018
Contents
Metabolite CPD-12897
- smiles:
- CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J
- common name:
- 7-methyl-3-oxooct-6-enoyl-CoA
- molecular weight:
- 915.695
- Synonym(s):
- 7-methyl-3-oxo-6-octenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.