Difference between revisions of "CPD-7066"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.36-RXN 2.4.1.36-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha,alpha-trehalose...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == * smiles: ** CC(C(=O)[O-])C(O)C([O-])=O * inchi key: ** InChIKey=NPYQJIHH...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C(=O)[O-])C(O)C([O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L | ||
* common name: | * common name: | ||
− | ** | + | ** (2R,3S)-3-methylmalate |
− | * | + | * molecular weight: |
− | ** | + | ** 146.099 |
* Synonym(s): | * Synonym(s): | ||
+ | ** D-erythro-3-methylmalate | ||
+ | ** erythro-β-methyl-D-malate | ||
+ | ** β-erythro-methylmalate | ||
+ | ** β-methyl-D-malate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-7745]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266666 45266666] |
− | * LIGAND- | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58511 58511] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06029 C06029] |
− | {{#set: | + | {{#set: smiles=CC(C(=O)[O-])C(O)C([O-])=O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L}} |
− | {{#set: | + | {{#set: common name=(2R,3S)-3-methylmalate}} |
− | {{#set: | + | {{#set: molecular weight=146.099 }} |
− | + | {{#set: common name=D-erythro-3-methylmalate|erythro-β-methyl-D-malate|β-erythro-methylmalate|β-methyl-D-malate}} | |
− | + | {{#set: consumed by=RXN-7745}} |
Latest revision as of 19:40, 21 March 2018
Contents
Metabolite CPD-7066
- smiles:
- CC(C(=O)[O-])C(O)C([O-])=O
- inchi key:
- InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L
- common name:
- (2R,3S)-3-methylmalate
- molecular weight:
- 146.099
- Synonym(s):
- D-erythro-3-methylmalate
- erythro-β-methyl-D-malate
- β-erythro-methylmalate
- β-methyl-D-malate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(=O)[O-])C(O)C([O-])=O" cannot be used as a page name in this wiki.