Difference between revisions of "CPD-558"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-05_002680 == * left end position: ** 4342061 * transcription direction: ** NEGATIVE * right end position: ** 4351077 * centisome position: ** 47.6...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-05_002680 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] ==
* left end position:
+
* smiles:
** 4342061
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I
* right end position:
+
* common name:
** 4351077
+
** pimeloyl-CoA
* centisome position:
+
* molecular weight:
** 47.69659    
+
** 904.649    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0004_0179
+
** 6-carboxyhexanoyl-CoA
** Esi0004_0179
+
** pimelyl-CoA
** TPS
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN1G-1435]]
+
* [[7KAPSYN-RXN]]
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
== Reaction(s) of unknown directionality ==
* [[RXN1G-1436]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN1G-1437]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN1G-1438]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[RXN1G-1439]]
+
** esiliculosus_genome
+
***automated-name-match
+
* [[TREHALOSE6PSYN-RXN]]
+
** esiliculosus_genome
+
***ec-number
+
* [[TREHALOSEPHOSPHA-RXN]]
+
** esiliculosus_genome
+
***automated-name-match
+
== Pathways associated ==
+
* [[TREHALOSESYN-PWY]]
+
* [[PWYG-321]]
+
* [[PWY-881]]
+
* [[TRESYN-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=4342061}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266589 45266589]
{{#set: right end position=4351077}}
+
* CHEBI:
{{#set: centisome position=47.69659   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57360 57360]
{{#set: common name=Esi_0004_0179|Esi0004_0179|TPS}}
+
* BIGG : 36728
{{#set: reaction associated=RXN1G-1435|RXN1G-1436|RXN1G-1437|RXN1G-1438|RXN1G-1439|TREHALOSE6PSYN-RXN|TREHALOSEPHOSPHA-RXN}}
+
* LIGAND-CPD:
{{#set: pathway associated=TREHALOSESYN-PWY|PWYG-321|PWY-881|TRESYN-PWY}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01063 C01063]
 +
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: inchi key=InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I}}
 +
{{#set: common name=pimeloyl-CoA}}
 +
{{#set: molecular weight=904.649   }}
 +
{{#set: common name=6-carboxyhexanoyl-CoA|pimelyl-CoA}}
 +
{{#set: consumed by=7KAPSYN-RXN}}

Latest revision as of 19:50, 21 March 2018

Metabolite CPD-558

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I
  • common name:
    • pimeloyl-CoA
  • molecular weight:
    • 904.649
  • Synonym(s):
    • 6-carboxyhexanoyl-CoA
    • pimelyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.