Difference between revisions of "Ec-11 001030"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C...")
 
(Created page with "Category:Gene == Gene Ec-11_001030 == * left end position: ** 1118259 * transcription direction: ** NEGATIVE * right end position: ** 1128035 * centisome position: ** 17.7...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] ==
+
== Gene Ec-11_001030 ==
−
* smiles:
+
* left end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 1118259
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** dihydrogeranylgeranyl chlorophyll a
+
** 1128035
−
* molecular weight:
+
* centisome position:
−
** 888.463    
+
** 17.77933    
 
* Synonym(s):
 
* Synonym(s):
−
** dihydrogeranylgeranyl-chl a
+
** Esi_0102_0078
−
** dihydroGG-chl a
+
** Esi0102_0078
−
** dihydroGG-chlorophyll a
+
** IDI1 SQS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7665]]
+
* Reaction: [[IPPISOM-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-7664]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-12263]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-13162]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13724]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN66-281]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6174]]
 +
* [[PWY-6859]]
 +
* [[NONMEVIPP-PWY]]
 +
* [[PWY-7560]]
 +
* [[PWY-7391]]
 +
* [[PWY-6767]]
 +
* [[PWY-5670]]
 +
* [[PWY-5123]]
 +
* [[PWY-922]]
 +
* [[PWY-5875]]
 +
* [[PWY-6383]]
 +
* [[PWY-6105]]
 +
* [[PWY-7072]]
 +
* [[PWY-7102]]
 +
* [[PWY-7524]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1118259}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926294 46926294]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: right end position=1128035}}
−
{{#set: inchi key=InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M}}
+
{{#set: centisome position=17.77933   }}
−
{{#set: common name=dihydrogeranylgeranyl chlorophyll a}}
+
{{#set: common name=Esi_0102_0078|Esi0102_0078|IDI1 SQS}}
−
{{#set: molecular weight=888.463   }}
+
{{#set: reaction associated=IPPISOM-RXN|RXN-12263|RXN-13162|RXN-13724|RXN66-281}}
−
{{#set: common name=dihydrogeranylgeranyl-chl a|dihydroGG-chl a|dihydroGG-chlorophyll a}}
+
{{#set: pathway associated=PWY-6174|PWY-6859|NONMEVIPP-PWY|PWY-7560|PWY-7391|PWY-6767|PWY-5670|PWY-5123|PWY-922|PWY-5875|PWY-6383|PWY-6105|PWY-7072|PWY-7102|PWY-7524}}
−
{{#set: consumed by=RXN-7665}}
+
−
{{#set: produced by=RXN-7664}}
+

Latest revision as of 19:58, 21 March 2018

Gene Ec-11_001030

  • left end position:
    • 1118259
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1128035
  • centisome position:
    • 17.77933
  • Synonym(s):
    • Esi_0102_0078
    • Esi0102_0078
    • IDI1 SQS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-11_001030&oldid=30607"