Difference between revisions of "5-HYDROXY-FERULIC-ACID"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-19_000120 == * Synonym(s): ** Esi_0328_0037 ** Esi0328_0037 == Reactions associated == * RXN-8443 ** pantograph-aragem == Pathways as...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == * smiles: ** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == |
+ | * smiles: | ||
+ | ** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M | ||
+ | * common name: | ||
+ | ** 5-hydroxyferulate | ||
+ | * molecular weight: | ||
+ | ** 209.178 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5-hydroxy ferulic acid |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-3422]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-1121]] |
− | + | == Reaction(s) of unknown directionality == | |
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740354 54740354] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05619 C05619] | ||
+ | * HMDB : HMDB35484 | ||
+ | {{#set: smiles=COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)}} | ||
+ | {{#set: inchi key=InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M}} | ||
+ | {{#set: common name=5-hydroxyferulate}} | ||
+ | {{#set: molecular weight=209.178 }} | ||
+ | {{#set: common name=5-hydroxy ferulic acid}} | ||
+ | {{#set: consumed by=RXN-3422}} | ||
+ | {{#set: produced by=RXN-1121}} |
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite 5-HYDROXY-FERULIC-ACID
- smiles:
- COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)
- inchi key:
- InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M
- common name:
- 5-hydroxyferulate
- molecular weight:
- 209.178
- Synonym(s):
- 5-hydroxy ferulic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)" cannot be used as a page name in this wiki.