Difference between revisions of "ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_010520 == * left end position: ** 8859494 * transcription direction: ** NEGATIVE * right end position: ** 8866184 * centisome position: ** 85.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER] == * smiles:...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=O)NC3(C(CC(C(=O)[O-])(OC1(C(O)C(OC(CO)C(O)1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O) |
− | * | + | * common name: |
− | ** | + | ** α-N-acetylneuraminyl-(2→3)-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** α-N-acetylneuraminyl-2,3-β-D-galactosyl-1,4-N-acetyl-D-glucosaminyl-glycoprotein |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[2.4.99.6-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04907 C04907] | |
− | {{#set: | + | {{#set: smiles=CC(=O)NC3(C(CC(C(=O)[O-])(OC1(C(O)C(OC(CO)C(O)1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)}} |
− | {{#set: | + | {{#set: common name=α-N-acetylneuraminyl-(2→3)-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R}} |
− | {{#set: common name= | + | {{#set: common name=α-N-acetylneuraminyl-2,3-β-D-galactosyl-1,4-N-acetyl-D-glucosaminyl-glycoprotein}} |
− | {{#set: | + | {{#set: produced by=2.4.99.6-RXN}} |
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER
- smiles:
- CC(=O)NC3(C(CC(C(=O)[O-])(OC1(C(O)C(OC(CO)C(O)1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)
- common name:
- α-N-acetylneuraminyl-(2→3)-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R
- Synonym(s):
- α-N-acetylneuraminyl-2,3-β-D-galactosyl-1,4-N-acetyl-D-glucosaminyl-glycoprotein
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIGAND-CPD:
"CC(=O)NC3(C(CC(C(=O)[O-])(OC1(C(O)C(OC(CO)C(O)1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)" cannot be used as a page name in this wiki.