Difference between revisions of "TRYPSYN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N(C)2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRYPSYN-RXN TRYPSYN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Tryptophan synthase bet...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRYPSYN-RXN TRYPSYN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Tryptophan synthase beta subunit-like PLP-dependent enzyme |
− | * | + | ** Tryptophan synthase, beta chain |
− | ** | + | ** Tryptophan synthase (alpha / beta chains) |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/4.2.1.20 EC-4.2.1.20] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[INDOLE-3-GLYCEROL-P]][c] '''+''' 1 [[SER]][c] '''=>''' 1 [[GAP]][c] '''+''' 1 [[TRP]][c] '''+''' 1 [[WATER]][c] |
− | == | + | * With common name(s): |
+ | ** 1 (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate[c] '''+''' 1 L-serine[c] '''=>''' 1 D-glyceraldehyde 3-phosphate[c] '''+''' 1 L-tryptophan[c] '''+''' 1 H2O[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-00_008830]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-17_002680]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-24_004010]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-20_002800]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-24_002360]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-27_001950]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-06_007490]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Ec-01_012080]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10532 10532] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02722 R02722] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P11081 P11081] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P14671 P14671] |
− | * | + | ** [http://www.uniprot.org/uniprot/P13228 P13228] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P18284 P18284] |
− | * | + | ** [http://www.uniprot.org/uniprot/P43759 P43759] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O84172 O84172] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P11080 P11080] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P16608 P16608] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P18285 P18285] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P16706 P16706] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P12290 P12290] |
+ | ** [http://www.uniprot.org/uniprot/P42391 P42391] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9PIF2 Q9PIF2] | ||
+ | ** [http://www.uniprot.org/uniprot/P12291 P12291] | ||
+ | ** [http://www.uniprot.org/uniprot/P42389 P42389] | ||
+ | ** [http://www.uniprot.org/uniprot/Q60179 Q60179] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9PIF1 Q9PIF1] | ||
+ | ** [http://www.uniprot.org/uniprot/P07600 P07600] | ||
+ | ** [http://www.uniprot.org/uniprot/P07601 P07601] | ||
+ | ** [http://www.uniprot.org/uniprot/P06561 P06561] | ||
+ | ** [http://www.uniprot.org/uniprot/P56142 P56142] | ||
+ | ** [http://www.uniprot.org/uniprot/P06562 P06562] | ||
+ | ** [http://www.uniprot.org/uniprot/O27696 O27696] | ||
+ | ** [http://www.uniprot.org/uniprot/O28672 O28672] | ||
+ | ** [http://www.uniprot.org/uniprot/O66923 O66923] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9JVC0 Q9JVC0] | ||
+ | ** [http://www.uniprot.org/uniprot/P43760 P43760] | ||
+ | ** [http://www.uniprot.org/uniprot/P34817 P34817] | ||
+ | ** [http://www.uniprot.org/uniprot/P34816 P34816] | ||
+ | ** [http://www.uniprot.org/uniprot/P17167 P17167] | ||
+ | ** [http://www.uniprot.org/uniprot/P17166 P17166] | ||
+ | ** [http://www.uniprot.org/uniprot/P19868 P19868] | ||
+ | ** [http://www.uniprot.org/uniprot/P19867 P19867] | ||
+ | ** [http://www.uniprot.org/uniprot/P16578 P16578] | ||
+ | ** [http://www.uniprot.org/uniprot/P43283 P43283] | ||
+ | ** [http://www.uniprot.org/uniprot/P43284 P43284] | ||
+ | ** [http://www.uniprot.org/uniprot/Q57011 Q57011] | ||
+ | ** [http://www.uniprot.org/uniprot/P31204 P31204] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01998 Q01998] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01997 Q01997] | ||
+ | ** [http://www.uniprot.org/uniprot/P34793 P34793] | ||
+ | ** [http://www.uniprot.org/uniprot/P42390 P42390] | ||
+ | ** [http://www.uniprot.org/uniprot/P50909 P50909] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42529 Q42529] | ||
+ | ** [http://www.uniprot.org/uniprot/P51382 P51382] | ||
+ | ** [http://www.uniprot.org/uniprot/P77960 P77960] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59992 Q59992] | ||
+ | ** [http://www.uniprot.org/uniprot/O22765 O22765] | ||
+ | ** [http://www.uniprot.org/uniprot/O04225 O04225] | ||
+ | ** [http://www.uniprot.org/uniprot/P25269 P25269] | ||
+ | ** [http://www.uniprot.org/uniprot/O64991 O64991] | ||
+ | ** [http://www.uniprot.org/uniprot/O05625 O05625] | ||
+ | ** [http://www.uniprot.org/uniprot/O13831 O13831] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9YGB0 Q9YGB0] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9YGA9 Q9YGA9] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9X7C8 Q9X7C8] | ||
+ | ** [http://www.uniprot.org/uniprot/P00931 P00931] | ||
+ | ** [http://www.uniprot.org/uniprot/P00929 P00929] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A2K1 P0A2K1] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A877 P0A877] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A879 P0A879] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=Tryptophan synthase beta subunit-like PLP-dependent enzyme}} | ||
+ | {{#set: common name=Tryptophan synthase, beta chain}} | ||
+ | {{#set: common name=Tryptophan synthase (alpha / beta chains)}} | ||
+ | {{#set: ec number=EC-4.2.1.20}} | ||
+ | {{#set: gene associated=Ec-00_008830|Ec-17_002680|Ec-24_004010|Ec-20_002800|Ec-24_002360|Ec-27_001950|Ec-06_007490|Ec-01_012080}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:01, 21 March 2018
Contents
Reaction TRYPSYN-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Tryptophan synthase beta subunit-like PLP-dependent enzyme
- Tryptophan synthase, beta chain
- Tryptophan synthase (alpha / beta chains)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 INDOLE-3-GLYCEROL-P[c] + 1 SER[c] => 1 GAP[c] + 1 TRP[c] + 1 WATER[c]
- With common name(s):
- 1 (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate[c] + 1 L-serine[c] => 1 D-glyceraldehyde 3-phosphate[c] + 1 L-tryptophan[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-00_008830
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-17_002680
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-24_004010
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-20_002800
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-24_002360
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Gene: Ec-27_001950
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Gene: Ec-06_007490
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
- Gene: Ec-01_012080
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT:
- P11081
- P14671
- P13228
- P18284
- P43759
- O84172
- P11080
- P16608
- P18285
- P16706
- P12290
- P42391
- Q9PIF2
- P12291
- P42389
- Q60179
- Q9PIF1
- P07600
- P07601
- P06561
- P56142
- P06562
- O27696
- O28672
- O66923
- Q9JVC0
- P43760
- P34817
- P34816
- P17167
- P17166
- P19868
- P19867
- P16578
- P43283
- P43284
- Q57011
- P31204
- Q01998
- Q01997
- P34793
- P42390
- P50909
- Q42529
- P51382
- P77960
- Q59992
- O22765
- O04225
- P25269
- O64991
- O05625
- O13831
- Q9YGB0
- Q9YGA9
- Q9X7C8
- P00931
- P00929
- P0A2K1
- P0A877
- P0A879