Difference between revisions of "CPD1F-97"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Glucans Beta-D-Glucans] == * common name: ** a β-D glucan * Synonym(s): == Reactio...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] == |
+ | * smiles: | ||
+ | ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** gibberellin A15 (open lactone form) |
+ | * molecular weight: | ||
+ | ** 346.422 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** gibberellin A15 | ||
+ | ** GA15 | ||
+ | ** GA15 (open lactone form) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN1F-163]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN1F-162]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIPID_MAPS : LMPR0104170017 |
− | {{#set: produced by= | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245948 25245948] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29590 29590] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11860 C11860] | ||
+ | {{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}} | ||
+ | {{#set: inchi key=InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L}} | ||
+ | {{#set: common name=gibberellin A15 (open lactone form)}} | ||
+ | {{#set: molecular weight=346.422 }} | ||
+ | {{#set: common name=gibberellin A15|GA15|GA15 (open lactone form)}} | ||
+ | {{#set: consumed by=RXN1F-163}} | ||
+ | {{#set: produced by=RXN1F-162}} |
Latest revision as of 19:02, 21 March 2018
Contents
Metabolite CPD1F-97
- smiles:
- C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
- inchi key:
- InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L
- common name:
- gibberellin A15 (open lactone form)
- molecular weight:
- 346.422
- Synonym(s):
- gibberellin A15
- GA15
- GA15 (open lactone form)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.