Difference between revisions of "CYS-GLY"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-04_003190 == * left end position: ** 3251186 * transcription direction: ** NEGATIVE * right end position: ** 3257815 * centisome position: ** 49.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * inchi key: ** InChIKey=ZUKPVRWZD...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == |
− | * | + | * smiles: |
− | ** | + | ** C(C([O-])=O)NC(C(CS)[N+])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N |
− | * | + | * common name: |
− | ** | + | ** L-cysteinyl-glycine |
− | * | + | * molecular weight: |
− | ** | + | ** 178.206 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Cys-Gly |
− | ** | + | ** cysteinylglycine |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-6622]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[RXN-6601]] |
− | == | + | * [[RXN-9157]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : 1445980 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098621 7098621] |
− | {{#set: | + | * HMDB : HMDB00078 |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01419 C01419] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61694 61694] | ||
+ | * METABOLIGHTS : MTBLC4047 | ||
+ | {{#set: smiles=C(C([O-])=O)NC(C(CS)[N+])=O}} | ||
+ | {{#set: inchi key=InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N}} | ||
+ | {{#set: common name=L-cysteinyl-glycine}} | ||
+ | {{#set: molecular weight=178.206 }} | ||
+ | {{#set: common name=Cys-Gly|cysteinylglycine}} | ||
+ | {{#set: consumed by=RXN-6622}} | ||
+ | {{#set: produced by=RXN-6601|RXN-9157}} |
Latest revision as of 19:03, 21 March 2018
Contents
Metabolite CYS-GLY
- smiles:
- C(C([O-])=O)NC(C(CS)[N+])=O
- inchi key:
- InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N
- common name:
- L-cysteinyl-glycine
- molecular weight:
- 178.206
- Synonym(s):
- Cys-Gly
- cysteinylglycine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 1445980
- PUBCHEM:
- HMDB : HMDB00078
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC4047
"C(C([O-])=O)NC(C(CS)[N+])=O" cannot be used as a page name in this wiki.