Difference between revisions of "Ec-20 001460"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * smiles: ** C(S([O-])=O)C(=O)C(=O)[O-] * inchi key...") |
(Created page with "Category:Gene == Gene Ec-20_001460 == * Synonym(s): ** Esi_0023_0023 ** Esi0023_0023 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-20_001460 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0023_0023 |
− | ** | + | ** Esi0023_0023 |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-8443]] | |
− | == | + | ** Source: [[orthology-aragem]] |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-5381]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0023_0023|Esi0023_0023}} | |
− | + | {{#set: reaction associated=RXN-8443}} | |
− | + | {{#set: pathway associated=PWY-5381}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:06, 21 March 2018
Gene Ec-20_001460
- Synonym(s):
- Esi_0023_0023
- Esi0023_0023
Reactions associated
- Reaction: RXN-8443
- Source: orthology-aragem