Difference between revisions of "PWY-4821"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == * smiles: ** C(C=CC1(=C(C=CC=C1)O))(=O)[O-] * inchi key: ** InChIKey=PMOW...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4821 PWY-4821] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-82115 TAX-8...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4821 PWY-4821] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-82115 TAX-82115] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** UDP-D-xylose biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** UDP-xylose biosynthesis |
+ | ** UDPXyl biosynthesis | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''2''' reactions found over '''3''' reactions in the full pathway |
− | + | * [[PWY-7346]] | |
− | * [[ | + | ** 0 associated gene: |
− | == Reaction(s) | + | * [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]] |
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_007350]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-4821 PWY-4821] |
− | + | {{#set: taxonomic range=TAX-82115}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=UDP-D-xylose biosynthesis}} | |
− | + | {{#set: common name=UDP-xylose biosynthesis|UDPXyl biosynthesis}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=67.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:06, 21 March 2018
Pathway PWY-4821
- taxonomic range:
- common name:
- UDP-D-xylose biosynthesis
- Synonym(s):
- UDP-xylose biosynthesis
- UDPXyl biosynthesis
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- PWY-7346
- 0 associated gene:
- UDP-GLUCURONATE-DECARBOXYLASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: